C25H50NO2+ — CID 146259008
2-(2,2-dimethylpropyl)-5-[4-(2,2-dimethylpropyl)-1,1-dimethylpyrrolidin-1-ium-3-yl]-3,3,4,4-tetramethylpentanoic acid (PubChem CID 146259008) has the molecular formula C25H50NO2+ and a molecular weight of 396.68 g/mol. Its IUPAC name is 2-(2,2-dimethylpropyl)-5-[4-(2,2-dimethylpropyl)-1,1-dimethylpyrrolidin-1-ium-3-yl]-3,3,4,4-tetramethylpentanoic acid.
| Compound Name | 2-(2,2-dimethylpropyl)-5-[4-(2,2-dimethylpropyl)-1,1-dimethylpyrrolidin-1-ium-3-yl]-3,3,4,4-tetramethylpentanoic acid |
|---|---|
| PubChem CID | 146259008 |
| Molecular Formula | C25H50NO2+ |
| Molecular Weight | 396.68 g/mol |
| Exact Mass | 396.38 |
| IUPAC Name | 2-(2,2-dimethylpropyl)-5-[4-(2,2-dimethylpropyl)-1,1-dimethylpyrrolidin-1-ium-3-yl]-3,3,4,4-tetramethylpentanoic acid |
| SMILES | CC(C)(C)CC1C[N+](C)(C)CC1CC(C)(C)C(C)(C)C(CC(C)(C)C)C(=O)O |
| InChI | InChI=1S/C25H49NO2/c1-22(2,3)13-18-16-26(11,12)17-19(18)14-24(7,8)25(9,10)20(21(27)28)15-23(4,5)6/h18-20H,13-17H2,1-12H3/p+1 |
| InChIKey | BTTLZWOCMCHDFB-UHFFFAOYSA-O |
| XLogP | 6.32 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.68 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|