About (Z)-3-methanimidoylpent-3-ene-1,4-diamine
(Z)-3-methanimidoylpent-3-ene-1,4-diamine (PubChem CID 146259093) has the molecular formula C6H13N3
and a molecular weight of 127.19 g/mol. Its IUPAC name is (Z)-3-methanimidoylpent-3-ene-1,4-diamine.
Molecular Properties
| Compound Name | (Z)-3-methanimidoylpent-3-ene-1,4-diamine |
| PubChem CID | 146259093 |
| Molecular Formula | C6H13N3 |
| Molecular Weight | 127.19 g/mol |
| Exact Mass | 127.11 |
| IUPAC Name | (Z)-3-methanimidoylpent-3-ene-1,4-diamine |
| SMILES | [H]/N=C/C(CCN)=C(/C)N |
| InChI | InChI=1S/C6H13N3/c1-5(9)6(4-8)2-3-7/h4,8H,2-3,7,9H2,1H3/b6-5-,8-4+ |
| InChIKey | YTUZZPKVVULIRI-QNMAEOQASA-N |
| XLogP | 0.22 |
| TPSA | 75.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 127.19 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (Z)-3-methanimidoylpent-3-ene-1,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-3-methanimidoylpent-3-ene-1,4-diamine?
The IUPAC name of (Z)-3-methanimidoylpent-3-ene-1,4-diamine (CID 146259093) is (Z)-3-methanimidoylpent-3-ene-1,4-diamine.
What is the SMILES notation for (Z)-3-methanimidoylpent-3-ene-1,4-diamine?
The canonical SMILES for (Z)-3-methanimidoylpent-3-ene-1,4-diamine is [H]/N=C/C(CCN)=C(/C)N.
What is the InChIKey of (Z)-3-methanimidoylpent-3-ene-1,4-diamine?
The InChIKey is YTUZZPKVVULIRI-QNMAEOQASA-N. The full InChI is InChI=1S/C6H13N3/c1-5(9)6(4-8)2-3-7/h4,8H,2-3,7,9H2,1H3/b6-5-,8-4+.
What are the key properties of (Z)-3-methanimidoylpent-3-ene-1,4-diamine?
(Z)-3-methanimidoylpent-3-ene-1,4-diamine has a molecular weight of 127.19 g/mol, XLogP of 0.22, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-3-methanimidoylpent-3-ene-1,4-diamine is sourced from PubChem (CID 146259093), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).