C9H14N2 — CID 146259124
N'-[(2E,4Z)-4-methylhepta-2,4,6-trien-3-yl]methanimidamide (PubChem CID 146259124) has the molecular formula C9H14N2 and a molecular weight of 150.22 g/mol. Its IUPAC name is N'-[(2E,4Z)-4-methylhepta-2,4,6-trien-3-yl]methanimidamide.
| Compound Name | N'-[(2E,4Z)-4-methylhepta-2,4,6-trien-3-yl]methanimidamide |
|---|---|
| PubChem CID | 146259124 |
| Molecular Formula | C9H14N2 |
| Molecular Weight | 150.22 g/mol |
| Exact Mass | 150.12 |
| IUPAC Name | N'-[(2E,4Z)-4-methylhepta-2,4,6-trien-3-yl]methanimidamide |
| SMILES | C=C/C=C(C)\C(=C/C)\N=C\N |
| InChI | InChI=1S/C9H14N2/c1-4-6-8(3)9(5-2)11-7-10/h4-7H,1H2,2-3H3,(H2,10,11)/b8-6-,9-5+ |
| InChIKey | ZCWRGEXWQJWCIX-POEMVANMSA-N |
| XLogP | 2.01 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.22 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|