C10H19NO4 — CID 146259147
N-[(3R,5S)-3,5,6-trihydroxyhexyl]but-3-enamide (PubChem CID 146259147) has the molecular formula C10H19NO4 and a molecular weight of 217.26 g/mol. Its IUPAC name is N-[(3R,5S)-3,5,6-trihydroxyhexyl]but-3-enamide.
| Compound Name | N-[(3R,5S)-3,5,6-trihydroxyhexyl]but-3-enamide |
|---|---|
| PubChem CID | 146259147 |
| Molecular Formula | C10H19NO4 |
| Molecular Weight | 217.26 g/mol |
| Exact Mass | 217.13 |
| IUPAC Name | N-[(3R,5S)-3,5,6-trihydroxyhexyl]but-3-enamide |
| SMILES | C=CCC(=O)NCC[C@@H](O)C[C@H](O)CO |
| InChI | InChI=1S/C10H19NO4/c1-2-3-10(15)11-5-4-8(13)6-9(14)7-12/h2,8-9,12-14H,1,3-7H2,(H,11,15)/t8-,9+/m1/s1 |
| InChIKey | RUTNLNCPNGUUTA-BDAKNGLRSA-N |
| XLogP | -0.83 |
| TPSA | 89.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.26 |
| LogP ≤ 5 | -0.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|