About N-[(5S)-5,6-dihydroxyhexyl]but-3-enamide
N-[(5S)-5,6-dihydroxyhexyl]but-3-enamide (PubChem CID 146259148) has the molecular formula C10H19NO3
and a molecular weight of 201.27 g/mol. Its IUPAC name is N-[(5S)-5,6-dihydroxyhexyl]but-3-enamide.
Molecular Properties
| Compound Name | N-[(5S)-5,6-dihydroxyhexyl]but-3-enamide |
| PubChem CID | 146259148 |
| Molecular Formula | C10H19NO3 |
| Molecular Weight | 201.27 g/mol |
| Exact Mass | 201.14 |
| IUPAC Name | N-[(5S)-5,6-dihydroxyhexyl]but-3-enamide |
| SMILES | C=CCC(=O)NCCCC[C@H](O)CO |
| InChI | InChI=1S/C10H19NO3/c1-2-5-10(14)11-7-4-3-6-9(13)8-12/h2,9,12-13H,1,3-8H2,(H,11,14)/t9-/m0/s1 |
| InChIKey | XLOIMXIMFORJJG-VIFPVBQESA-N |
| XLogP | 0.20 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.27 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-[(5S)-5,6-dihydroxyhexyl]but-3-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(5S)-5,6-dihydroxyhexyl]but-3-enamide?
The IUPAC name of N-[(5S)-5,6-dihydroxyhexyl]but-3-enamide (CID 146259148) is N-[(5S)-5,6-dihydroxyhexyl]but-3-enamide.
What is the SMILES notation for N-[(5S)-5,6-dihydroxyhexyl]but-3-enamide?
The canonical SMILES for N-[(5S)-5,6-dihydroxyhexyl]but-3-enamide is C=CCC(=O)NCCCC[C@H](O)CO.
What is the InChIKey of N-[(5S)-5,6-dihydroxyhexyl]but-3-enamide?
The InChIKey is XLOIMXIMFORJJG-VIFPVBQESA-N. The full InChI is InChI=1S/C10H19NO3/c1-2-5-10(14)11-7-4-3-6-9(13)8-12/h2,9,12-13H,1,3-8H2,(H,11,14)/t9-/m0/s1.
What are the key properties of N-[(5S)-5,6-dihydroxyhexyl]but-3-enamide?
N-[(5S)-5,6-dihydroxyhexyl]but-3-enamide has a molecular weight of 201.27 g/mol, XLogP of 0.20, 8 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(5S)-5,6-dihydroxyhexyl]but-3-enamide is sourced from PubChem (CID 146259148), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).