About (2Z,4E)-4-fluorohexa-2,4-dienethial
(2Z,4E)-4-fluorohexa-2,4-dienethial (PubChem CID 146259187) has the molecular formula C6H7FS
and a molecular weight of 130.19 g/mol. Its IUPAC name is (2Z,4E)-4-fluorohexa-2,4-dienethial.
Molecular Properties
| Compound Name | (2Z,4E)-4-fluorohexa-2,4-dienethial |
| PubChem CID | 146259187 |
| Molecular Formula | C6H7FS |
| Molecular Weight | 130.19 g/mol |
| Exact Mass | 130.03 |
| IUPAC Name | (2Z,4E)-4-fluorohexa-2,4-dienethial |
| SMILES | C/C=C(F)\C=C/C=S |
| InChI | InChI=1S/C6H7FS/c1-2-6(7)4-3-5-8/h2-5H,1H3/b4-3-,6-2+ |
| InChIKey | FSYFRFCEERYKEI-FSEBUJBSSA-N |
| XLogP | 2.42 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 130.19 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze (2Z,4E)-4-fluorohexa-2,4-dienethial with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2Z,4E)-4-fluorohexa-2,4-dienethial?
The IUPAC name of (2Z,4E)-4-fluorohexa-2,4-dienethial (CID 146259187) is (2Z,4E)-4-fluorohexa-2,4-dienethial.
What is the SMILES notation for (2Z,4E)-4-fluorohexa-2,4-dienethial?
The canonical SMILES for (2Z,4E)-4-fluorohexa-2,4-dienethial is C/C=C(F)\C=C/C=S.
What is the InChIKey of (2Z,4E)-4-fluorohexa-2,4-dienethial?
The InChIKey is FSYFRFCEERYKEI-FSEBUJBSSA-N. The full InChI is InChI=1S/C6H7FS/c1-2-6(7)4-3-5-8/h2-5H,1H3/b4-3-,6-2+.
What are the key properties of (2Z,4E)-4-fluorohexa-2,4-dienethial?
(2Z,4E)-4-fluorohexa-2,4-dienethial has a molecular weight of 130.19 g/mol, XLogP of 2.42, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2Z,4E)-4-fluorohexa-2,4-dienethial is sourced from PubChem (CID 146259187), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).