About triethyl-[(Z,2Z)-2-(1-hydroxyethylidene)-4-(methylamino)pent-3-enyl]azanium
triethyl-[(Z,2Z)-2-(1-hydroxyethylidene)-4-(methylamino)pent-3-enyl]azanium (PubChem CID 146259255) has the molecular formula C14H29N2O+
and a molecular weight of 241.40 g/mol. Its IUPAC name is triethyl-[(Z,2Z)-2-(1-hydroxyethylidene)-4-(methylamino)pent-3-enyl]azanium.
Molecular Properties
| Compound Name | triethyl-[(Z,2Z)-2-(1-hydroxyethylidene)-4-(methylamino)pent-3-enyl]azanium |
| PubChem CID | 146259255 |
| Molecular Formula | C14H29N2O+ |
| Molecular Weight | 241.40 g/mol |
| Exact Mass | 241.23 |
| IUPAC Name | triethyl-[(Z,2Z)-2-(1-hydroxyethylidene)-4-(methylamino)pent-3-enyl]azanium |
| SMILES | CC[N+](CC)(CC)CC(/C=C(/C)NC)=C(/C)O |
| InChI | InChI=1S/C14H28N2O/c1-7-16(8-2,9-3)11-14(13(5)17)10-12(4)15-6/h10,15H,7-9,11H2,1-6H3/p+1/b12-10-,14-13- |
| InChIKey | ZMMZUCFGBWNUSM-MMQYBTMXSA-O |
| XLogP | 2.82 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.40 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze triethyl-[(Z,2Z)-2-(1-hydroxyethylidene)-4-(methylamino)pent-3-enyl]azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of triethyl-[(Z,2Z)-2-(1-hydroxyethylidene)-4-(methylamino)pent-3-enyl]azanium?
The IUPAC name of triethyl-[(Z,2Z)-2-(1-hydroxyethylidene)-4-(methylamino)pent-3-enyl]azanium (CID 146259255) is triethyl-[(Z,2Z)-2-(1-hydroxyethylidene)-4-(methylamino)pent-3-enyl]azanium.
What is the SMILES notation for triethyl-[(Z,2Z)-2-(1-hydroxyethylidene)-4-(methylamino)pent-3-enyl]azanium?
The canonical SMILES for triethyl-[(Z,2Z)-2-(1-hydroxyethylidene)-4-(methylamino)pent-3-enyl]azanium is CC[N+](CC)(CC)CC(/C=C(/C)NC)=C(/C)O.
What is the InChIKey of triethyl-[(Z,2Z)-2-(1-hydroxyethylidene)-4-(methylamino)pent-3-enyl]azanium?
The InChIKey is ZMMZUCFGBWNUSM-MMQYBTMXSA-O. The full InChI is InChI=1S/C14H28N2O/c1-7-16(8-2,9-3)11-14(13(5)17)10-12(4)15-6/h10,15H,7-9,11H2,1-6H3/p+1/b12-10-,14-13-.
What are the key properties of triethyl-[(Z,2Z)-2-(1-hydroxyethylidene)-4-(methylamino)pent-3-enyl]azanium?
triethyl-[(Z,2Z)-2-(1-hydroxyethylidene)-4-(methylamino)pent-3-enyl]azanium has a molecular weight of 241.40 g/mol, XLogP of 2.82, 7 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for triethyl-[(Z,2Z)-2-(1-hydroxyethylidene)-4-(methylamino)pent-3-enyl]azanium is sourced from PubChem (CID 146259255), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).