C11H15N — CID 146259336
3,4,7-trimethyl-6,7-dihydro-1H-isoindole (PubChem CID 146259336) has the molecular formula C11H15N and a molecular weight of 161.25 g/mol. Its IUPAC name is 3,4,7-trimethyl-6,7-dihydro-1H-isoindole.
| Compound Name | 3,4,7-trimethyl-6,7-dihydro-1H-isoindole |
|---|---|
| PubChem CID | 146259336 |
| Molecular Formula | C11H15N |
| Molecular Weight | 161.25 g/mol |
| Exact Mass | 161.12 |
| IUPAC Name | 3,4,7-trimethyl-6,7-dihydro-1H-isoindole |
| SMILES | CC1=CCC(C)C2=C1C(C)=NC2 |
| InChI | InChI=1S/C11H15N/c1-7-4-5-8(2)11-9(3)12-6-10(7)11/h5,7H,4,6H2,1-3H3 |
| InChIKey | TXTOWGHTNVQGHM-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.25 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |