C25H30N4O3 — CID 146259431
7-[[2-(N-[(3E,5Z)-hepta-1,3,5-trien-3-yl]anilino)pyrimidine-5-carbonyl]amino]heptanoic acid (PubChem CID 146259431) has the molecular formula C25H30N4O3 and a molecular weight of 434.54 g/mol. Its IUPAC name is 7-[[2-(N-[(3E,5Z)-hepta-1,3,5-trien-3-yl]anilino)pyrimidine-5-carbonyl]amino]heptanoic acid.
| Compound Name | 7-[[2-(N-[(3E,5Z)-hepta-1,3,5-trien-3-yl]anilino)pyrimidine-5-carbonyl]amino]heptanoic acid |
|---|---|
| PubChem CID | 146259431 |
| Molecular Formula | C25H30N4O3 |
| Molecular Weight | 434.54 g/mol |
| Exact Mass | 434.23 |
| IUPAC Name | 7-[[2-(N-[(3E,5Z)-hepta-1,3,5-trien-3-yl]anilino)pyrimidine-5-carbonyl]amino]heptanoic acid |
| SMILES | C=C/C(=C\C=C/C)N(c1ccccc1)c1ncc(C(=O)NCCCCCCC(=O)O)cn1 |
| InChI | InChI=1S/C25H30N4O3/c1-3-5-13-21(4-2)29(22-14-9-8-10-15-22)25-27-18-20(19-28-25)24(32)26-17-12-7-6-11-16-23(30)31/h3-5,8-10,13-15,18-19H,2,6-7,11-12,16-17H2,1H3,(H,26,32)(H,30,31)/b5-3-,21-13+ |
| InChIKey | MZHLEHKVVFFJMK-BWFWUWGJSA-N |
| XLogP | 5.03 |
| TPSA | 95.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.54 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|