About 1-[(2Z)-7,7-dimethylcyclonon-2-en-1-yl]-1,2-dimethylhydrazine
1-[(2Z)-7,7-dimethylcyclonon-2-en-1-yl]-1,2-dimethylhydrazine (PubChem CID 146259463) has the molecular formula C13H26N2
and a molecular weight of 210.36 g/mol. Its IUPAC name is 1-[(2Z)-7,7-dimethylcyclonon-2-en-1-yl]-1,2-dimethylhydrazine.
Molecular Properties
| Compound Name | 1-[(2Z)-7,7-dimethylcyclonon-2-en-1-yl]-1,2-dimethylhydrazine |
| PubChem CID | 146259463 |
| Molecular Formula | C13H26N2 |
| Molecular Weight | 210.36 g/mol |
| Exact Mass | 210.21 |
| IUPAC Name | 1-[(2Z)-7,7-dimethylcyclonon-2-en-1-yl]-1,2-dimethylhydrazine |
| SMILES | CNN(C)C1/C=C\CCCC(C)(C)CC1 |
| InChI | InChI=1S/C13H26N2/c1-13(2)10-7-5-6-8-12(9-11-13)15(4)14-3/h6,8,12,14H,5,7,9-11H2,1-4H3/b8-6- |
| InChIKey | BQUCFPCWOXOKJH-VURMDHGXSA-N |
| XLogP | 2.97 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.36 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-[(2Z)-7,7-dimethylcyclonon-2-en-1-yl]-1,2-dimethylhydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(2Z)-7,7-dimethylcyclonon-2-en-1-yl]-1,2-dimethylhydrazine?
The IUPAC name of 1-[(2Z)-7,7-dimethylcyclonon-2-en-1-yl]-1,2-dimethylhydrazine (CID 146259463) is 1-[(2Z)-7,7-dimethylcyclonon-2-en-1-yl]-1,2-dimethylhydrazine.
What is the SMILES notation for 1-[(2Z)-7,7-dimethylcyclonon-2-en-1-yl]-1,2-dimethylhydrazine?
The canonical SMILES for 1-[(2Z)-7,7-dimethylcyclonon-2-en-1-yl]-1,2-dimethylhydrazine is CNN(C)C1/C=C\CCCC(C)(C)CC1.
What is the InChIKey of 1-[(2Z)-7,7-dimethylcyclonon-2-en-1-yl]-1,2-dimethylhydrazine?
The InChIKey is BQUCFPCWOXOKJH-VURMDHGXSA-N. The full InChI is InChI=1S/C13H26N2/c1-13(2)10-7-5-6-8-12(9-11-13)15(4)14-3/h6,8,12,14H,5,7,9-11H2,1-4H3/b8-6-.
What are the key properties of 1-[(2Z)-7,7-dimethylcyclonon-2-en-1-yl]-1,2-dimethylhydrazine?
1-[(2Z)-7,7-dimethylcyclonon-2-en-1-yl]-1,2-dimethylhydrazine has a molecular weight of 210.36 g/mol, XLogP of 2.97, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(2Z)-7,7-dimethylcyclonon-2-en-1-yl]-1,2-dimethylhydrazine is sourced from PubChem (CID 146259463), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).