About N-[(1E,3Z)-1-propan-2-yloxypenta-1,3-dienyl]methanimine
N-[(1E,3Z)-1-propan-2-yloxypenta-1,3-dienyl]methanimine (PubChem CID 146259584) has the molecular formula C9H15NO
and a molecular weight of 153.22 g/mol. Its IUPAC name is N-[(1E,3Z)-1-propan-2-yloxypenta-1,3-dienyl]methanimine.
Molecular Properties
| Compound Name | N-[(1E,3Z)-1-propan-2-yloxypenta-1,3-dienyl]methanimine |
| PubChem CID | 146259584 |
| Molecular Formula | C9H15NO |
| Molecular Weight | 153.22 g/mol |
| Exact Mass | 153.12 |
| IUPAC Name | N-[(1E,3Z)-1-propan-2-yloxypenta-1,3-dienyl]methanimine |
| SMILES | C=N/C(=C\C=C/C)OC(C)C |
| InChI | InChI=1S/C9H15NO/c1-5-6-7-9(10-4)11-8(2)3/h5-8H,4H2,1-3H3/b6-5-,9-7+ |
| InChIKey | ZFLYGANMPVDNRJ-BZWSEGBZSA-N |
| XLogP | 2.53 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.22 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze N-[(1E,3Z)-1-propan-2-yloxypenta-1,3-dienyl]methanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(1E,3Z)-1-propan-2-yloxypenta-1,3-dienyl]methanimine?
The IUPAC name of N-[(1E,3Z)-1-propan-2-yloxypenta-1,3-dienyl]methanimine (CID 146259584) is N-[(1E,3Z)-1-propan-2-yloxypenta-1,3-dienyl]methanimine.
What is the SMILES notation for N-[(1E,3Z)-1-propan-2-yloxypenta-1,3-dienyl]methanimine?
The canonical SMILES for N-[(1E,3Z)-1-propan-2-yloxypenta-1,3-dienyl]methanimine is C=N/C(=C\C=C/C)OC(C)C.
What is the InChIKey of N-[(1E,3Z)-1-propan-2-yloxypenta-1,3-dienyl]methanimine?
The InChIKey is ZFLYGANMPVDNRJ-BZWSEGBZSA-N. The full InChI is InChI=1S/C9H15NO/c1-5-6-7-9(10-4)11-8(2)3/h5-8H,4H2,1-3H3/b6-5-,9-7+.
What are the key properties of N-[(1E,3Z)-1-propan-2-yloxypenta-1,3-dienyl]methanimine?
N-[(1E,3Z)-1-propan-2-yloxypenta-1,3-dienyl]methanimine has a molecular weight of 153.22 g/mol, XLogP of 2.53, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(1E,3Z)-1-propan-2-yloxypenta-1,3-dienyl]methanimine is sourced from PubChem (CID 146259584), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).