About 1-[2-[2-[2-[2-(2-oxo-1,3-dioxolan-4-ylidene)ethoxy]ethoxy]ethoxy]ethoxy]pent-2-en-3-yl acetate
1-[2-[2-[2-[2-(2-oxo-1,3-dioxolan-4-ylidene)ethoxy]ethoxy]ethoxy]ethoxy]pent-2-en-3-yl acetate (PubChem CID 146259932) has the molecular formula C18H28O9
and a molecular weight of 388.41 g/mol. Its IUPAC name is 1-[2-[2-[2-[2-(2-oxo-1,3-dioxolan-4-ylidene)ethoxy]ethoxy]ethoxy]ethoxy]pent-2-en-3-yl acetate.
Molecular Properties
| Compound Name | 1-[2-[2-[2-[2-(2-oxo-1,3-dioxolan-4-ylidene)ethoxy]ethoxy]ethoxy]ethoxy]pent-2-en-3-yl acetate |
| PubChem CID | 146259932 |
| Molecular Formula | C18H28O9 |
| Molecular Weight | 388.41 g/mol |
| Exact Mass | 388.17 |
| IUPAC Name | 1-[2-[2-[2-[2-(2-oxo-1,3-dioxolan-4-ylidene)ethoxy]ethoxy]ethoxy]ethoxy]pent-2-en-3-yl acetate |
| SMILES | CCC(=CCOCCOCCOCCOCC=C1COC(=O)O1)OC(C)=O |
| InChI | InChI=1S/C18H28O9/c1-3-16(26-15(2)19)4-6-21-8-10-23-12-13-24-11-9-22-7-5-17-14-25-18(20)27-17/h4-5H,3,6-14H2,1-2H3 |
| InChIKey | XLBMGGJZMGNMHM-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 98.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 388.41 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-[2-[2-[2-[2-(2-oxo-1,3-dioxolan-4-ylidene)ethoxy]ethoxy]ethoxy]ethoxy]pent-2-en-3-yl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-[2-[2-[2-(2-oxo-1,3-dioxolan-4-ylidene)ethoxy]ethoxy]ethoxy]ethoxy]pent-2-en-3-yl acetate?
The IUPAC name of 1-[2-[2-[2-[2-(2-oxo-1,3-dioxolan-4-ylidene)ethoxy]ethoxy]ethoxy]ethoxy]pent-2-en-3-yl acetate (CID 146259932) is 1-[2-[2-[2-[2-(2-oxo-1,3-dioxolan-4-ylidene)ethoxy]ethoxy]ethoxy]ethoxy]pent-2-en-3-yl acetate.
What is the SMILES notation for 1-[2-[2-[2-[2-(2-oxo-1,3-dioxolan-4-ylidene)ethoxy]ethoxy]ethoxy]ethoxy]pent-2-en-3-yl acetate?
The canonical SMILES for 1-[2-[2-[2-[2-(2-oxo-1,3-dioxolan-4-ylidene)ethoxy]ethoxy]ethoxy]ethoxy]pent-2-en-3-yl acetate is CCC(=CCOCCOCCOCCOCC=C1COC(=O)O1)OC(C)=O.
What is the InChIKey of 1-[2-[2-[2-[2-(2-oxo-1,3-dioxolan-4-ylidene)ethoxy]ethoxy]ethoxy]ethoxy]pent-2-en-3-yl acetate?
The InChIKey is XLBMGGJZMGNMHM-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H28O9/c1-3-16(26-15(2)19)4-6-21-8-10-23-12-13-24-11-9-22-7-5-17-14-25-18(20)27-17/h4-5H,3,6-14H2,1-2H3.
What are the key properties of 1-[2-[2-[2-[2-(2-oxo-1,3-dioxolan-4-ylidene)ethoxy]ethoxy]ethoxy]ethoxy]pent-2-en-3-yl acetate?
1-[2-[2-[2-[2-(2-oxo-1,3-dioxolan-4-ylidene)ethoxy]ethoxy]ethoxy]ethoxy]pent-2-en-3-yl acetate has a molecular weight of 388.41 g/mol, XLogP of 1.96, 15 rotatable bonds, 0 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-[2-[2-[2-(2-oxo-1,3-dioxolan-4-ylidene)ethoxy]ethoxy]ethoxy]ethoxy]pent-2-en-3-yl acetate is sourced from PubChem (CID 146259932), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).