C25H35BrN8OS — CID 146260201
N'-[1-(5-amino-1H-1,2,4-triazol-3-yl)piperidin-4-yl]-N'-[2-(4-bromophenyl)ethyl]-N-(N,4-dimethylanilino)sulfanyloxyethane-1,2-diamine (PubChem CID 146260201) has the molecular formula C25H35BrN8OS and a molecular weight of 575.58 g/mol. Its IUPAC name is N'-[1-(5-amino-1H-1,2,4-triazol-3-yl)piperidin-4-yl]-N'-[2-(4-bromophenyl)ethyl]-N-(N,4-dimethylanilino)sulfanyloxyethane-1,2-diamine.
| Compound Name | N'-[1-(5-amino-1H-1,2,4-triazol-3-yl)piperidin-4-yl]-N'-[2-(4-bromophenyl)ethyl]-N-(N,4-dimethylanilino)sulfanyloxyethane-1,2-diamine |
|---|---|
| PubChem CID | 146260201 |
| Molecular Formula | C25H35BrN8OS |
| Molecular Weight | 575.58 g/mol |
| Exact Mass | 574.18 |
| IUPAC Name | N'-[1-(5-amino-1H-1,2,4-triazol-3-yl)piperidin-4-yl]-N'-[2-(4-bromophenyl)ethyl]-N-(N,4-dimethylanilino)sulfanyloxyethane-1,2-diamine |
| SMILES | Cc1ccc(N(C)SONCCN(CCc2ccc(Br)cc2)C2CCN(c3n[nH]c(N)n3)CC2)cc1 |
| InChI | InChI=1S/C25H35BrN8OS/c1-19-3-9-22(10-4-19)32(2)36-35-28-14-18-33(15-11-20-5-7-21(26)8-6-20)23-12-16-34(17-13-23)25-29-24(27)30-31-25/h3-10,23,28H,11-18H2,1-2H3,(H3,27,29,30,31) |
| InChIKey | RFQMBZFBJNVKRU-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 98.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.58 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|