C23H32N6O — CID 146260374
2-(4-hydrazinyl-2-methylpentoxy)-5-[2-(piperidin-4-ylamino)-4-pyridinyl]benzonitrile (PubChem CID 146260374) has the molecular formula C23H32N6O and a molecular weight of 408.55 g/mol. Its IUPAC name is 2-(4-hydrazinyl-2-methylpentoxy)-5-[2-(piperidin-4-ylamino)-4-pyridinyl]benzonitrile.
| Compound Name | 2-(4-hydrazinyl-2-methylpentoxy)-5-[2-(piperidin-4-ylamino)-4-pyridinyl]benzonitrile |
|---|---|
| PubChem CID | 146260374 |
| Molecular Formula | C23H32N6O |
| Molecular Weight | 408.55 g/mol |
| Exact Mass | 408.26 |
| IUPAC Name | 2-(4-hydrazinyl-2-methylpentoxy)-5-[2-(piperidin-4-ylamino)-4-pyridinyl]benzonitrile |
| SMILES | CC(COc1ccc(-c2ccnc(NC3CCNCC3)c2)cc1C#N)CC(C)NN |
| InChI | InChI=1S/C23H32N6O/c1-16(11-17(2)29-25)15-30-22-4-3-18(12-20(22)14-24)19-5-10-27-23(13-19)28-21-6-8-26-9-7-21/h3-5,10,12-13,16-17,21,26,29H,6-9,11,15,25H2,1-2H3,(H,27,28) |
| InChIKey | LVVXVYHUKFLCGU-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 108.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.55 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|