C14H24N2O2 — CID 146260635
(3R,4R)-1-[(2S,4Z,6Z)-2-(methylamino)-3-methylideneocta-4,6-dienyl]pyrrolidine-3,4-diol (PubChem CID 146260635) has the molecular formula C14H24N2O2 and a molecular weight of 252.36 g/mol. Its IUPAC name is (3R,4R)-1-[(2S,4Z,6Z)-2-(methylamino)-3-methylideneocta-4,6-dienyl]pyrrolidine-3,4-diol.
| Compound Name | (3R,4R)-1-[(2S,4Z,6Z)-2-(methylamino)-3-methylideneocta-4,6-dienyl]pyrrolidine-3,4-diol |
|---|---|
| PubChem CID | 146260635 |
| Molecular Formula | C14H24N2O2 |
| Molecular Weight | 252.36 g/mol |
| Exact Mass | 252.18 |
| IUPAC Name | (3R,4R)-1-[(2S,4Z,6Z)-2-(methylamino)-3-methylideneocta-4,6-dienyl]pyrrolidine-3,4-diol |
| SMILES | C=C(/C=C\C=C/C)[C@@H](CN1C[C@@H](O)[C@H](O)C1)NC |
| InChI | InChI=1S/C14H24N2O2/c1-4-5-6-7-11(2)12(15-3)8-16-9-13(17)14(18)10-16/h4-7,12-15,17-18H,2,8-10H2,1,3H3/b5-4-,7-6-/t12-,13-,14-/m1/s1 |
| InChIKey | YCWHMQFJHIVQCM-DFUJCXCXSA-N |
| XLogP | 0.30 |
| TPSA | 55.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.36 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|