C15H21NO4 — CID 146260817
methyl (3'aS,4'R,5'R,7'aR)-7'a-cyano-5'-methylspiro[1,3-dioxolane-2,3'-2,3a,4,5,6,7-hexahydro-1H-indene]-4'-carboxylate (PubChem CID 146260817) has the molecular formula C15H21NO4 and a molecular weight of 279.34 g/mol. Its IUPAC name is methyl (3'aS,4'R,5'R,7'aR)-7'a-cyano-5'-methylspiro[1,3-dioxolane-2,3'-2,3a,4,5,6,7-hexahydro-1H-indene]-4'-carboxylate.
| Compound Name | methyl (3'aS,4'R,5'R,7'aR)-7'a-cyano-5'-methylspiro[1,3-dioxolane-2,3'-2,3a,4,5,6,7-hexahydro-1H-indene]-4'-carboxylate |
|---|---|
| PubChem CID | 146260817 |
| Molecular Formula | C15H21NO4 |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.15 |
| IUPAC Name | methyl (3'aS,4'R,5'R,7'aR)-7'a-cyano-5'-methylspiro[1,3-dioxolane-2,3'-2,3a,4,5,6,7-hexahydro-1H-indene]-4'-carboxylate |
| SMILES | COC(=O)[C@@H]1[C@H](C)CC[C@@]2(C#N)CCC3(OCCO3)[C@@H]12 |
| InChI | InChI=1S/C15H21NO4/c1-10-3-4-14(9-16)5-6-15(19-7-8-20-15)12(14)11(10)13(17)18-2/h10-12H,3-8H2,1-2H3/t10-,11-,12+,14+/m1/s1 |
| InChIKey | IEJGHISRZDXWLM-NMKXLXIOSA-N |
| XLogP | 1.87 |
| TPSA | 68.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |