C26H25F2NS — CID 146262152
5-[2-[4-(4-cyclopentylcyclohexyl)phenyl]ethynyl]-1,3-difluoro-2-isothiocyanatobenzene (PubChem CID 146262152) has the molecular formula C26H25F2NS and a molecular weight of 421.56 g/mol. Its IUPAC name is 5-[2-[4-(4-cyclopentylcyclohexyl)phenyl]ethynyl]-1,3-difluoro-2-isothiocyanatobenzene.
| Compound Name | 5-[2-[4-(4-cyclopentylcyclohexyl)phenyl]ethynyl]-1,3-difluoro-2-isothiocyanatobenzene |
|---|---|
| PubChem CID | 146262152 |
| Molecular Formula | C26H25F2NS |
| Molecular Weight | 421.56 g/mol |
| Exact Mass | 421.17 |
| IUPAC Name | 5-[2-[4-(4-cyclopentylcyclohexyl)phenyl]ethynyl]-1,3-difluoro-2-isothiocyanatobenzene |
| SMILES | Fc1cc(C#Cc2ccc(C3CCC(C4CCCC4)CC3)cc2)cc(F)c1N=C=S |
| InChI | InChI=1S/C26H25F2NS/c27-24-15-19(16-25(28)26(24)29-17-30)6-5-18-7-9-21(10-8-18)23-13-11-22(12-14-23)20-3-1-2-4-20/h7-10,15-16,20,22-23H,1-4,11-14H2 |
| InChIKey | SORBPRXKORINHI-UHFFFAOYSA-N |
| XLogP | 7.56 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.56 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|