C28H24FN7O3 — CID 146262196
3-[10-(2,5-diazabicyclo[2.2.1]heptane-2-carbonyl)-6-fluoro-1,10-diazatricyclo[6.4.1.04,13]trideca-2,4,6,8(13)-tetraen-3-yl]-4-imidazo[1,2-a]pyridin-3-ylpyrrole-2,5-dione (PubChem CID 146262196) has the molecular formula C28H24FN7O3 and a molecular weight of 525.54 g/mol. Its IUPAC name is 3-[10-(2,5-diazabicyclo[2.2.1]heptane-2-carbonyl)-6-fluoro-1,10-diazatricyclo[6.4.1.04,13]trideca-2,4,6,8(13)-tetraen-3-yl]-4-imidazo[1,2-a]pyridin-3-ylpyrrole-2,5-dione.
| Compound Name | 3-[10-(2,5-diazabicyclo[2.2.1]heptane-2-carbonyl)-6-fluoro-1,10-diazatricyclo[6.4.1.04,13]trideca-2,4,6,8(13)-tetraen-3-yl]-4-imidazo[1,2-a]pyridin-3-ylpyrrole-2,5-dione |
|---|---|
| PubChem CID | 146262196 |
| Molecular Formula | C28H24FN7O3 |
| Molecular Weight | 525.54 g/mol |
| Exact Mass | 525.19 |
| IUPAC Name | 3-[10-(2,5-diazabicyclo[2.2.1]heptane-2-carbonyl)-6-fluoro-1,10-diazatricyclo[6.4.1.04,13]trideca-2,4,6,8(13)-tetraen-3-yl]-4-imidazo[1,2-a]pyridin-3-ylpyrrole-2,5-dione |
| SMILES | O=C1NC(=O)C(c2cnc3ccccn23)=C1c1cn2c3c(cc(F)cc13)CN(C(=O)N1CC3CC1CN3)CC2 |
| InChI | InChI=1S/C28H24FN7O3/c29-16-7-15-12-34(28(39)36-13-17-9-18(36)10-30-17)6-5-33-14-20(19(8-16)25(15)33)23-24(27(38)32-26(23)37)21-11-31-22-3-1-2-4-35(21)22/h1-4,7-8,11,14,17-18,30H,5-6,9-10,12-13H2,(H,32,37,38) |
| InChIKey | CEKCXTRFNKWBIP-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 103.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.54 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|