C30H25F3N6O4 — CID 146262230
3-imidazo[1,2-a]pyridin-3-yl-4-[10-(8-oxa-3-azabicyclo[3.2.1]octane-3-carbonyl)-6-(trifluoromethyl)-1,10-diazatricyclo[6.4.1.04,13]trideca-2,4,6,8(13)-tetraen-3-yl]pyrrole-2,5-dione (PubChem CID 146262230) has the molecular formula C30H25F3N6O4 and a molecular weight of 590.56 g/mol. Its IUPAC name is 3-imidazo[1,2-a]pyridin-3-yl-4-[10-(8-oxa-3-azabicyclo[3.2.1]octane-3-carbonyl)-6-(trifluoromethyl)-1,10-diazatricyclo[6.4.1.04,13]trideca-2,4,6,8(13)-tetraen-3-yl]pyrrole-2,5-dione.
| Compound Name | 3-imidazo[1,2-a]pyridin-3-yl-4-[10-(8-oxa-3-azabicyclo[3.2.1]octane-3-carbonyl)-6-(trifluoromethyl)-1,10-diazatricyclo[6.4.1.04,13]trideca-2,4,6,8(13)-tetraen-3-yl]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 146262230 |
| Molecular Formula | C30H25F3N6O4 |
| Molecular Weight | 590.56 g/mol |
| Exact Mass | 590.19 |
| IUPAC Name | 3-imidazo[1,2-a]pyridin-3-yl-4-[10-(8-oxa-3-azabicyclo[3.2.1]octane-3-carbonyl)-6-(trifluoromethyl)-1,10-diazatricyclo[6.4.1.04,13]trideca-2,4,6,8(13)-tetraen-3-yl]pyrrole-2,5-dione |
| SMILES | O=C1NC(=O)C(c2cnc3ccccn23)=C1c1cn2c3c(cc(C(F)(F)F)cc13)CN(C(=O)N1CC3CCC(C1)O3)CC2 |
| InChI | InChI=1S/C30H25F3N6O4/c31-30(32,33)17-9-16-12-37(29(42)38-13-18-4-5-19(14-38)43-18)8-7-36-15-21(20(10-17)26(16)36)24-25(28(41)35-27(24)40)22-11-34-23-3-1-2-6-39(22)23/h1-3,6,9-11,15,18-19H,4-5,7-8,12-14H2,(H,35,40,41) |
| InChIKey | MBYMKNRTLQOPEX-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 101.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.56 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|