C17H20O3 — CID 146262352
5-[(E)-2-(4-prop-2-enoxycyclohexa-1,3-dien-1-yl)ethenyl]cyclohexa-1,5-diene-1,3-diol (PubChem CID 146262352) has the molecular formula C17H20O3 and a molecular weight of 272.34 g/mol. Its IUPAC name is 5-[(E)-2-(4-prop-2-enoxycyclohexa-1,3-dien-1-yl)ethenyl]cyclohexa-1,5-diene-1,3-diol.
| Compound Name | 5-[(E)-2-(4-prop-2-enoxycyclohexa-1,3-dien-1-yl)ethenyl]cyclohexa-1,5-diene-1,3-diol |
|---|---|
| PubChem CID | 146262352 |
| Molecular Formula | C17H20O3 |
| Molecular Weight | 272.34 g/mol |
| Exact Mass | 272.14 |
| IUPAC Name | 5-[(E)-2-(4-prop-2-enoxycyclohexa-1,3-dien-1-yl)ethenyl]cyclohexa-1,5-diene-1,3-diol |
| SMILES | C=CCOC1=CC=C(/C=C/C2=CC(O)=CC(O)C2)CC1 |
| InChI | InChI=1S/C17H20O3/c1-2-9-20-17-7-5-13(6-8-17)3-4-14-10-15(18)12-16(19)11-14/h2-5,7,10,12,16,18-19H,1,6,8-9,11H2/b4-3+ |
| InChIKey | OEKUDRHIQPKXIE-ONEGZZNKSA-N |
| XLogP | 3.48 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.34 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|