C8F6N2 — CID 146262522
2,3,4,6,7,8-hexafluoro-1,5-naphthyridine (PubChem CID 146262522) has the molecular formula C8F6N2 and a molecular weight of 238.09 g/mol. Its IUPAC name is 2,3,4,6,7,8-hexafluoro-1,5-naphthyridine.
| Compound Name | 2,3,4,6,7,8-hexafluoro-1,5-naphthyridine |
|---|---|
| PubChem CID | 146262522 |
| Molecular Formula | C8F6N2 |
| Molecular Weight | 238.09 g/mol |
| Exact Mass | 238.00 |
| IUPAC Name | 2,3,4,6,7,8-hexafluoro-1,5-naphthyridine |
| SMILES | Fc1nc2c(F)c(F)c(F)nc2c(F)c1F |
| InChI | InChI=1S/C8F6N2/c9-1-3(11)7(13)16-6-2(10)4(12)8(14)15-5(1)6 |
| InChIKey | DIQUULKGKRSANT-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.09 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|