C26H10F4N4S2 — CID 146262534
4-[4-([1]benzothiolo[3,2-d]pyrimidin-4-yl)-2,3,5,6-tetrafluorophenyl]-[1]benzothiolo[3,2-d]pyrimidine (PubChem CID 146262534) has the molecular formula C26H10F4N4S2 and a molecular weight of 518.52 g/mol. Its IUPAC name is 4-[4-([1]benzothiolo[3,2-d]pyrimidin-4-yl)-2,3,5,6-tetrafluorophenyl]-[1]benzothiolo[3,2-d]pyrimidine.
| Compound Name | 4-[4-([1]benzothiolo[3,2-d]pyrimidin-4-yl)-2,3,5,6-tetrafluorophenyl]-[1]benzothiolo[3,2-d]pyrimidine |
|---|---|
| PubChem CID | 146262534 |
| Molecular Formula | C26H10F4N4S2 |
| Molecular Weight | 518.52 g/mol |
| Exact Mass | 518.03 |
| IUPAC Name | 4-[4-([1]benzothiolo[3,2-d]pyrimidin-4-yl)-2,3,5,6-tetrafluorophenyl]-[1]benzothiolo[3,2-d]pyrimidine |
| SMILES | Fc1c(F)c(-c2ncnc3c2sc2ccccc23)c(F)c(F)c1-c1ncnc2c1sc1ccccc12 |
| InChI | InChI=1S/C26H10F4N4S2/c27-17-15(23-25-21(31-9-33-23)11-5-1-3-7-13(11)35-25)18(28)20(30)16(19(17)29)24-26-22(32-10-34-24)12-6-2-4-8-14(12)36-26/h1-10H |
| InChIKey | UKYFFBCPIMZEND-UHFFFAOYSA-N |
| XLogP | 7.89 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.52 |
| LogP ≤ 5 | 7.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|