C24H36O3 — CID 146262729
4-[(3S,5R,9R,10S,13R,17S)-3-hydroxy-10,13-dimethyl-2,3,4,5,6,7,9,11,12,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]-4-methyloxolan-2-one (PubChem CID 146262729) has the molecular formula C24H36O3 and a molecular weight of 372.55 g/mol. Its IUPAC name is 4-[(3S,5R,9R,10S,13R,17S)-3-hydroxy-10,13-dimethyl-2,3,4,5,6,7,9,11,12,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]-4-methyloxolan-2-one.
| Compound Name | 4-[(3S,5R,9R,10S,13R,17S)-3-hydroxy-10,13-dimethyl-2,3,4,5,6,7,9,11,12,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]-4-methyloxolan-2-one |
|---|---|
| PubChem CID | 146262729 |
| Molecular Formula | C24H36O3 |
| Molecular Weight | 372.55 g/mol |
| Exact Mass | 372.27 |
| IUPAC Name | 4-[(3S,5R,9R,10S,13R,17S)-3-hydroxy-10,13-dimethyl-2,3,4,5,6,7,9,11,12,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]-4-methyloxolan-2-one |
| SMILES | CC1([C@H]2CCC3=C4CC[C@@H]5C[C@@H](O)CC[C@]5(C)[C@H]4CC[C@@]32C)COC(=O)C1 |
| InChI | InChI=1S/C24H36O3/c1-22(13-21(26)27-14-22)20-7-6-18-17-5-4-15-12-16(25)8-10-23(15,2)19(17)9-11-24(18,20)3/h15-16,19-20,25H,4-14H2,1-3H3/t15-,16+,19+,20-,22?,23+,24+/m1/s1 |
| InChIKey | AYQGREUSSXNUAH-JOVMDOSASA-N |
| XLogP | 5.02 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.55 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|