C28H42N2O3S — CID 146262975
5-[6-[4-(cyclooctylmethoxy)phenyl]sulfanylcyclodecyl]imidazolidine-2,4-dione (PubChem CID 146262975) has the molecular formula C28H42N2O3S and a molecular weight of 486.72 g/mol. Its IUPAC name is 5-[6-[4-(cyclooctylmethoxy)phenyl]sulfanylcyclodecyl]imidazolidine-2,4-dione.
| Compound Name | 5-[6-[4-(cyclooctylmethoxy)phenyl]sulfanylcyclodecyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 146262975 |
| Molecular Formula | C28H42N2O3S |
| Molecular Weight | 486.72 g/mol |
| Exact Mass | 486.29 |
| IUPAC Name | 5-[6-[4-(cyclooctylmethoxy)phenyl]sulfanylcyclodecyl]imidazolidine-2,4-dione |
| SMILES | O=C1NC(=O)C(C2CCCCC(Sc3ccc(OCC4CCCCCCC4)cc3)CCCC2)N1 |
| InChI | InChI=1S/C28H42N2O3S/c31-27-26(29-28(32)30-27)22-12-6-8-14-24(15-9-7-13-22)34-25-18-16-23(17-19-25)33-20-21-10-4-2-1-3-5-11-21/h16-19,21-22,24,26H,1-15,20H2,(H2,29,30,31,32) |
| InChIKey | SOOSTZOYMRMEFN-UHFFFAOYSA-N |
| XLogP | 6.85 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.72 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|