About pyrimido[5,4-b]indol-5-amine
pyrimido[5,4-b]indol-5-amine (PubChem CID 146263517) has the molecular formula C10H8N4
and a molecular weight of 184.20 g/mol. Its IUPAC name is pyrimido[5,4-b]indol-5-amine.
Molecular Properties
| Compound Name | pyrimido[5,4-b]indol-5-amine |
| PubChem CID | 146263517 |
| Molecular Formula | C10H8N4 |
| Molecular Weight | 184.20 g/mol |
| Exact Mass | 184.07 |
| IUPAC Name | pyrimido[5,4-b]indol-5-amine |
| SMILES | Nn1c2ccccc2c2ncncc21 |
| InChI | InChI=1S/C10H8N4/c11-14-8-4-2-1-3-7(8)10-9(14)5-12-6-13-10/h1-6H,11H2 |
| InChIKey | YCZACGBMOCTKPG-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.20 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze pyrimido[5,4-b]indol-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyrimido[5,4-b]indol-5-amine?
The IUPAC name of pyrimido[5,4-b]indol-5-amine (CID 146263517) is pyrimido[5,4-b]indol-5-amine.
What is the SMILES notation for pyrimido[5,4-b]indol-5-amine?
The canonical SMILES for pyrimido[5,4-b]indol-5-amine is Nn1c2ccccc2c2ncncc21.
What is the InChIKey of pyrimido[5,4-b]indol-5-amine?
The InChIKey is YCZACGBMOCTKPG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8N4/c11-14-8-4-2-1-3-7(8)10-9(14)5-12-6-13-10/h1-6H,11H2.
What are the key properties of pyrimido[5,4-b]indol-5-amine?
pyrimido[5,4-b]indol-5-amine has a molecular weight of 184.20 g/mol, XLogP of 1.30, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for pyrimido[5,4-b]indol-5-amine is sourced from PubChem (CID 146263517), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).