C15H15NO4 — CID 146263854
(3E,4E)-1-(2,4-dioxocyclohexyl)-3-ethylidene-4-prop-2-enylidenepyrrolidine-2,5-dione (PubChem CID 146263854) has the molecular formula C15H15NO4 and a molecular weight of 273.29 g/mol. Its IUPAC name is (3E,4E)-1-(2,4-dioxocyclohexyl)-3-ethylidene-4-prop-2-enylidenepyrrolidine-2,5-dione.
| Compound Name | (3E,4E)-1-(2,4-dioxocyclohexyl)-3-ethylidene-4-prop-2-enylidenepyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 146263854 |
| Molecular Formula | C15H15NO4 |
| Molecular Weight | 273.29 g/mol |
| Exact Mass | 273.10 |
| IUPAC Name | (3E,4E)-1-(2,4-dioxocyclohexyl)-3-ethylidene-4-prop-2-enylidenepyrrolidine-2,5-dione |
| SMILES | C=C/C=C1/C(=O)N(C2CCC(=O)CC2=O)C(=O)/C1=C/C |
| InChI | InChI=1S/C15H15NO4/c1-3-5-11-10(4-2)14(19)16(15(11)20)12-7-6-9(17)8-13(12)18/h3-5,12H,1,6-8H2,2H3/b10-4+,11-5+ |
| InChIKey | IUVSHQVHEYFKDM-ZVSIBQGLSA-N |
| XLogP | 1.10 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.29 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|