About [2-[(3,5-dichloro-2-pyridinyl)amino]-5-fluorophenyl]-methylcarbamic acid
[2-[(3,5-dichloro-2-pyridinyl)amino]-5-fluorophenyl]-methylcarbamic acid (PubChem CID 146264641) has the molecular formula C13H10Cl2FN3O2
and a molecular weight of 330.15 g/mol. Its IUPAC name is [2-[(3,5-dichloro-2-pyridinyl)amino]-5-fluorophenyl]-methylcarbamic acid.
Molecular Properties
| Compound Name | [2-[(3,5-dichloro-2-pyridinyl)amino]-5-fluorophenyl]-methylcarbamic acid |
| PubChem CID | 146264641 |
| Molecular Formula | C13H10Cl2FN3O2 |
| Molecular Weight | 330.15 g/mol |
| Exact Mass | 329.01 |
| IUPAC Name | [2-[(3,5-dichloro-2-pyridinyl)amino]-5-fluorophenyl]-methylcarbamic acid |
| SMILES | CN(C(=O)O)c1cc(F)ccc1Nc1ncc(Cl)cc1Cl |
| InChI | InChI=1S/C13H10Cl2FN3O2/c1-19(13(20)21)11-5-8(16)2-3-10(11)18-12-9(15)4-7(14)6-17-12/h2-6H,1H3,(H,17,18)(H,20,21) |
| InChIKey | FVLXFNAYEXHERA-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 65.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.15 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [2-[(3,5-dichloro-2-pyridinyl)amino]-5-fluorophenyl]-methylcarbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[(3,5-dichloro-2-pyridinyl)amino]-5-fluorophenyl]-methylcarbamic acid?
The IUPAC name of [2-[(3,5-dichloro-2-pyridinyl)amino]-5-fluorophenyl]-methylcarbamic acid (CID 146264641) is [2-[(3,5-dichloro-2-pyridinyl)amino]-5-fluorophenyl]-methylcarbamic acid.
What is the SMILES notation for [2-[(3,5-dichloro-2-pyridinyl)amino]-5-fluorophenyl]-methylcarbamic acid?
The canonical SMILES for [2-[(3,5-dichloro-2-pyridinyl)amino]-5-fluorophenyl]-methylcarbamic acid is CN(C(=O)O)c1cc(F)ccc1Nc1ncc(Cl)cc1Cl.
What is the InChIKey of [2-[(3,5-dichloro-2-pyridinyl)amino]-5-fluorophenyl]-methylcarbamic acid?
The InChIKey is FVLXFNAYEXHERA-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10Cl2FN3O2/c1-19(13(20)21)11-5-8(16)2-3-10(11)18-12-9(15)4-7(14)6-17-12/h2-6H,1H3,(H,17,18)(H,20,21).
What are the key properties of [2-[(3,5-dichloro-2-pyridinyl)amino]-5-fluorophenyl]-methylcarbamic acid?
[2-[(3,5-dichloro-2-pyridinyl)amino]-5-fluorophenyl]-methylcarbamic acid has a molecular weight of 330.15 g/mol, XLogP of 4.39, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[(3,5-dichloro-2-pyridinyl)amino]-5-fluorophenyl]-methylcarbamic acid is sourced from PubChem (CID 146264641), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).