About pentan-2-yl 2-[[(3-cyclopropylphenoxy)-methoxyphosphanyl]amino]acetate
pentan-2-yl 2-[[(3-cyclopropylphenoxy)-methoxyphosphanyl]amino]acetate (PubChem CID 146264889) has the molecular formula C17H26NO4P
and a molecular weight of 339.37 g/mol. Its IUPAC name is pentan-2-yl 2-[[(3-cyclopropylphenoxy)-methoxyphosphanyl]amino]acetate.
Molecular Properties
| Compound Name | pentan-2-yl 2-[[(3-cyclopropylphenoxy)-methoxyphosphanyl]amino]acetate |
| PubChem CID | 146264889 |
| Molecular Formula | C17H26NO4P |
| Molecular Weight | 339.37 g/mol |
| Exact Mass | 339.16 |
| IUPAC Name | pentan-2-yl 2-[[(3-cyclopropylphenoxy)-methoxyphosphanyl]amino]acetate |
| SMILES | CCCC(C)OC(=O)CNP(OC)Oc1cccc(C2CC2)c1 |
| InChI | InChI=1S/C17H26NO4P/c1-4-6-13(2)21-17(19)12-18-23(20-3)22-16-8-5-7-15(11-16)14-9-10-14/h5,7-8,11,13-14,18H,4,6,9-10,12H2,1-3H3 |
| InChIKey | ASBYVWHFUSHFME-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 339.37 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze pentan-2-yl 2-[[(3-cyclopropylphenoxy)-methoxyphosphanyl]amino]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pentan-2-yl 2-[[(3-cyclopropylphenoxy)-methoxyphosphanyl]amino]acetate?
The IUPAC name of pentan-2-yl 2-[[(3-cyclopropylphenoxy)-methoxyphosphanyl]amino]acetate (CID 146264889) is pentan-2-yl 2-[[(3-cyclopropylphenoxy)-methoxyphosphanyl]amino]acetate.
What is the SMILES notation for pentan-2-yl 2-[[(3-cyclopropylphenoxy)-methoxyphosphanyl]amino]acetate?
The canonical SMILES for pentan-2-yl 2-[[(3-cyclopropylphenoxy)-methoxyphosphanyl]amino]acetate is CCCC(C)OC(=O)CNP(OC)Oc1cccc(C2CC2)c1.
What is the InChIKey of pentan-2-yl 2-[[(3-cyclopropylphenoxy)-methoxyphosphanyl]amino]acetate?
The InChIKey is ASBYVWHFUSHFME-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H26NO4P/c1-4-6-13(2)21-17(19)12-18-23(20-3)22-16-8-5-7-15(11-16)14-9-10-14/h5,7-8,11,13-14,18H,4,6,9-10,12H2,1-3H3.
What are the key properties of pentan-2-yl 2-[[(3-cyclopropylphenoxy)-methoxyphosphanyl]amino]acetate?
pentan-2-yl 2-[[(3-cyclopropylphenoxy)-methoxyphosphanyl]amino]acetate has a molecular weight of 339.37 g/mol, XLogP of 4.14, 10 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for pentan-2-yl 2-[[(3-cyclopropylphenoxy)-methoxyphosphanyl]amino]acetate is sourced from PubChem (CID 146264889), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).