About 6-(methylideneamino)-N-(4-methylpent-4-enyl)cyclohexa-2,4-dien-1-amine
6-(methylideneamino)-N-(4-methylpent-4-enyl)cyclohexa-2,4-dien-1-amine (PubChem CID 146264934) has the molecular formula C13H20N2
and a molecular weight of 204.32 g/mol. Its IUPAC name is 6-(methylideneamino)-N-(4-methylpent-4-enyl)cyclohexa-2,4-dien-1-amine.
Molecular Properties
| Compound Name | 6-(methylideneamino)-N-(4-methylpent-4-enyl)cyclohexa-2,4-dien-1-amine |
| PubChem CID | 146264934 |
| Molecular Formula | C13H20N2 |
| Molecular Weight | 204.32 g/mol |
| Exact Mass | 204.16 |
| IUPAC Name | 6-(methylideneamino)-N-(4-methylpent-4-enyl)cyclohexa-2,4-dien-1-amine |
| SMILES | C=NC1C=CC=CC1NCCCC(=C)C |
| InChI | InChI=1S/C13H20N2/c1-11(2)7-6-10-15-13-9-5-4-8-12(13)14-3/h4-5,8-9,12-13,15H,1,3,6-7,10H2,2H3 |
| InChIKey | XDTVTGQZSRSBFD-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.32 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 6-(methylideneamino)-N-(4-methylpent-4-enyl)cyclohexa-2,4-dien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(methylideneamino)-N-(4-methylpent-4-enyl)cyclohexa-2,4-dien-1-amine?
The IUPAC name of 6-(methylideneamino)-N-(4-methylpent-4-enyl)cyclohexa-2,4-dien-1-amine (CID 146264934) is 6-(methylideneamino)-N-(4-methylpent-4-enyl)cyclohexa-2,4-dien-1-amine.
What is the SMILES notation for 6-(methylideneamino)-N-(4-methylpent-4-enyl)cyclohexa-2,4-dien-1-amine?
The canonical SMILES for 6-(methylideneamino)-N-(4-methylpent-4-enyl)cyclohexa-2,4-dien-1-amine is C=NC1C=CC=CC1NCCCC(=C)C.
What is the InChIKey of 6-(methylideneamino)-N-(4-methylpent-4-enyl)cyclohexa-2,4-dien-1-amine?
The InChIKey is XDTVTGQZSRSBFD-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20N2/c1-11(2)7-6-10-15-13-9-5-4-8-12(13)14-3/h4-5,8-9,12-13,15H,1,3,6-7,10H2,2H3.
What are the key properties of 6-(methylideneamino)-N-(4-methylpent-4-enyl)cyclohexa-2,4-dien-1-amine?
6-(methylideneamino)-N-(4-methylpent-4-enyl)cyclohexa-2,4-dien-1-amine has a molecular weight of 204.32 g/mol, XLogP of 2.50, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(methylideneamino)-N-(4-methylpent-4-enyl)cyclohexa-2,4-dien-1-amine is sourced from PubChem (CID 146264934), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).