About methyl (E)-2-cyclohexa-1,5-dien-1-yl-3-[(4-methyl-5-oxo-2H-furan-2-yl)oxy]prop-2-enoate
methyl (E)-2-cyclohexa-1,5-dien-1-yl-3-[(4-methyl-5-oxo-2H-furan-2-yl)oxy]prop-2-enoate (PubChem CID 146264963) has the molecular formula C15H16O5
and a molecular weight of 276.29 g/mol. Its IUPAC name is methyl (E)-2-cyclohexa-1,5-dien-1-yl-3-[(4-methyl-5-oxo-2H-furan-2-yl)oxy]prop-2-enoate.
Molecular Properties
| Compound Name | methyl (E)-2-cyclohexa-1,5-dien-1-yl-3-[(4-methyl-5-oxo-2H-furan-2-yl)oxy]prop-2-enoate |
| PubChem CID | 146264963 |
| Molecular Formula | C15H16O5 |
| Molecular Weight | 276.29 g/mol |
| Exact Mass | 276.10 |
| IUPAC Name | methyl (E)-2-cyclohexa-1,5-dien-1-yl-3-[(4-methyl-5-oxo-2H-furan-2-yl)oxy]prop-2-enoate |
| SMILES | COC(=O)/C(=C/OC1C=C(C)C(=O)O1)C1=CCCC=C1 |
| InChI | InChI=1S/C15H16O5/c1-10-8-13(20-14(10)16)19-9-12(15(17)18-2)11-6-4-3-5-7-11/h4,6-9,13H,3,5H2,1-2H3/b12-9+ |
| InChIKey | JBGOHDQVWWNWKP-FMIVXFBMSA-N |
| XLogP | 2.17 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.29 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze methyl (E)-2-cyclohexa-1,5-dien-1-yl-3-[(4-methyl-5-oxo-2H-furan-2-yl)oxy]prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (E)-2-cyclohexa-1,5-dien-1-yl-3-[(4-methyl-5-oxo-2H-furan-2-yl)oxy]prop-2-enoate?
The IUPAC name of methyl (E)-2-cyclohexa-1,5-dien-1-yl-3-[(4-methyl-5-oxo-2H-furan-2-yl)oxy]prop-2-enoate (CID 146264963) is methyl (E)-2-cyclohexa-1,5-dien-1-yl-3-[(4-methyl-5-oxo-2H-furan-2-yl)oxy]prop-2-enoate.
What is the SMILES notation for methyl (E)-2-cyclohexa-1,5-dien-1-yl-3-[(4-methyl-5-oxo-2H-furan-2-yl)oxy]prop-2-enoate?
The canonical SMILES for methyl (E)-2-cyclohexa-1,5-dien-1-yl-3-[(4-methyl-5-oxo-2H-furan-2-yl)oxy]prop-2-enoate is COC(=O)/C(=C/OC1C=C(C)C(=O)O1)C1=CCCC=C1.
What is the InChIKey of methyl (E)-2-cyclohexa-1,5-dien-1-yl-3-[(4-methyl-5-oxo-2H-furan-2-yl)oxy]prop-2-enoate?
The InChIKey is JBGOHDQVWWNWKP-FMIVXFBMSA-N. The full InChI is InChI=1S/C15H16O5/c1-10-8-13(20-14(10)16)19-9-12(15(17)18-2)11-6-4-3-5-7-11/h4,6-9,13H,3,5H2,1-2H3/b12-9+.
What are the key properties of methyl (E)-2-cyclohexa-1,5-dien-1-yl-3-[(4-methyl-5-oxo-2H-furan-2-yl)oxy]prop-2-enoate?
methyl (E)-2-cyclohexa-1,5-dien-1-yl-3-[(4-methyl-5-oxo-2H-furan-2-yl)oxy]prop-2-enoate has a molecular weight of 276.29 g/mol, XLogP of 2.17, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (E)-2-cyclohexa-1,5-dien-1-yl-3-[(4-methyl-5-oxo-2H-furan-2-yl)oxy]prop-2-enoate is sourced from PubChem (CID 146264963), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).