C10H22N2O2 — CID 146264990
6-piperazin-1-ylhexane-1,2-diol (PubChem CID 146264990) has the molecular formula C10H22N2O2 and a molecular weight of 202.30 g/mol. Its IUPAC name is 6-piperazin-1-ylhexane-1,2-diol.
| Compound Name | 6-piperazin-1-ylhexane-1,2-diol |
|---|---|
| PubChem CID | 146264990 |
| Molecular Formula | C10H22N2O2 |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.17 |
| IUPAC Name | 6-piperazin-1-ylhexane-1,2-diol |
| SMILES | OCC(O)CCCCN1CCNCC1 |
| InChI | InChI=1S/C10H22N2O2/c13-9-10(14)3-1-2-6-12-7-4-11-5-8-12/h10-11,13-14H,1-9H2 |
| InChIKey | KUULFLHQVFCHQV-UHFFFAOYSA-N |
| XLogP | -0.58 |
| TPSA | 55.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|