C16H15Cl2N3O4 — CID 146265325
N-(2,6-dichlorophenyl)-4,5-dihydro-1H-imidazol-2-amine;3,4-dihydroxybenzoic acid (PubChem CID 146265325) has the molecular formula C16H15Cl2N3O4 and a molecular weight of 384.22 g/mol. Its IUPAC name is N-(2,6-dichlorophenyl)-4,5-dihydro-1H-imidazol-2-amine;3,4-dihydroxybenzoic acid.
| Compound Name | N-(2,6-dichlorophenyl)-4,5-dihydro-1H-imidazol-2-amine;3,4-dihydroxybenzoic acid |
|---|---|
| PubChem CID | 146265325 |
| Molecular Formula | C16H15Cl2N3O4 |
| Molecular Weight | 384.22 g/mol |
| Exact Mass | 383.04 |
| IUPAC Name | N-(2,6-dichlorophenyl)-4,5-dihydro-1H-imidazol-2-amine;3,4-dihydroxybenzoic acid |
| SMILES | Clc1cccc(Cl)c1NC1=NCCN1.O=C(O)c1ccc(O)c(O)c1 |
| InChI | InChI=1S/C9H9Cl2N3.C7H6O4/c10-6-2-1-3-7(11)8(6)14-9-12-4-5-13-9;8-5-2-1-4(7(10)11)3-6(5)9/h1-3H,4-5H2,(H2,12,13,14);1-3,8-9H,(H,10,11) |
| InChIKey | PKHHLQGQKKMIEM-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 114.18 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.22 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|