C26H29F4N5O — CID 146265451
N-[1-(3-fluoropropyl)azetidin-3-yl]-6-[(1S,3S)-3-methyl-6-(1,2-oxazol-4-yl)-2-(2,2,2-trifluoroethyl)-3,4-dihydro-1H-isoquinolin-1-yl]pyridin-3-amine (PubChem CID 146265451) has the molecular formula C26H29F4N5O and a molecular weight of 503.54 g/mol. Its IUPAC name is N-[1-(3-fluoropropyl)azetidin-3-yl]-6-[(1S,3S)-3-methyl-6-(1,2-oxazol-4-yl)-2-(2,2,2-trifluoroethyl)-3,4-dihydro-1H-isoquinolin-1-yl]pyridin-3-amine.
| Compound Name | N-[1-(3-fluoropropyl)azetidin-3-yl]-6-[(1S,3S)-3-methyl-6-(1,2-oxazol-4-yl)-2-(2,2,2-trifluoroethyl)-3,4-dihydro-1H-isoquinolin-1-yl]pyridin-3-amine |
|---|---|
| PubChem CID | 146265451 |
| Molecular Formula | C26H29F4N5O |
| Molecular Weight | 503.54 g/mol |
| Exact Mass | 503.23 |
| IUPAC Name | N-[1-(3-fluoropropyl)azetidin-3-yl]-6-[(1S,3S)-3-methyl-6-(1,2-oxazol-4-yl)-2-(2,2,2-trifluoroethyl)-3,4-dihydro-1H-isoquinolin-1-yl]pyridin-3-amine |
| SMILES | C[C@H]1Cc2cc(-c3cnoc3)ccc2[C@@H](c2ccc(NC3CN(CCCF)C3)cn2)N1CC(F)(F)F |
| InChI | InChI=1S/C26H29F4N5O/c1-17-9-19-10-18(20-11-32-36-15-20)3-5-23(19)25(35(17)16-26(28,29)30)24-6-4-21(12-31-24)33-22-13-34(14-22)8-2-7-27/h3-6,10-12,15,17,22,25,33H,2,7-9,13-14,16H2,1H3/t17-,25-/m0/s1 |
| InChIKey | HXLSETIXKWXXHQ-GKVSMKOHSA-N |
| XLogP | 5.09 |
| TPSA | 57.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.54 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |