C11H22O — CID 146265564
(4S)-2,3,3,6-tetramethylhept-1-en-4-ol (PubChem CID 146265564) has the molecular formula C11H22O and a molecular weight of 170.30 g/mol. Its IUPAC name is (4S)-2,3,3,6-tetramethylhept-1-en-4-ol.
| Compound Name | (4S)-2,3,3,6-tetramethylhept-1-en-4-ol |
|---|---|
| PubChem CID | 146265564 |
| Molecular Formula | C11H22O |
| Molecular Weight | 170.30 g/mol |
| Exact Mass | 170.17 |
| IUPAC Name | (4S)-2,3,3,6-tetramethylhept-1-en-4-ol |
| SMILES | C=C(C)C(C)(C)[C@@H](O)CC(C)C |
| InChI | InChI=1S/C11H22O/c1-8(2)7-10(12)11(5,6)9(3)4/h8,10,12H,3,7H2,1-2,4-6H3/t10-/m0/s1 |
| InChIKey | JTOUHNZVLFXDSE-JTQLQIEISA-N |
| XLogP | 3.00 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.30 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|