About 1-(5-fluoro-6-methylcyclohexa-1,3-dien-1-yl)piperazine
1-(5-fluoro-6-methylcyclohexa-1,3-dien-1-yl)piperazine (PubChem CID 146265962) has the molecular formula C11H17FN2
and a molecular weight of 196.27 g/mol. Its IUPAC name is 1-(5-fluoro-6-methylcyclohexa-1,3-dien-1-yl)piperazine.
Molecular Properties
| Compound Name | 1-(5-fluoro-6-methylcyclohexa-1,3-dien-1-yl)piperazine |
| PubChem CID | 146265962 |
| Molecular Formula | C11H17FN2 |
| Molecular Weight | 196.27 g/mol |
| Exact Mass | 196.14 |
| IUPAC Name | 1-(5-fluoro-6-methylcyclohexa-1,3-dien-1-yl)piperazine |
| SMILES | CC1C(N2CCNCC2)=CC=CC1F |
| InChI | InChI=1S/C11H17FN2/c1-9-10(12)3-2-4-11(9)14-7-5-13-6-8-14/h2-4,9-10,13H,5-8H2,1H3 |
| InChIKey | LATHHGYEVWRFAP-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.27 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(5-fluoro-6-methylcyclohexa-1,3-dien-1-yl)piperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(5-fluoro-6-methylcyclohexa-1,3-dien-1-yl)piperazine?
The IUPAC name of 1-(5-fluoro-6-methylcyclohexa-1,3-dien-1-yl)piperazine (CID 146265962) is 1-(5-fluoro-6-methylcyclohexa-1,3-dien-1-yl)piperazine.
What is the SMILES notation for 1-(5-fluoro-6-methylcyclohexa-1,3-dien-1-yl)piperazine?
The canonical SMILES for 1-(5-fluoro-6-methylcyclohexa-1,3-dien-1-yl)piperazine is CC1C(N2CCNCC2)=CC=CC1F.
What is the InChIKey of 1-(5-fluoro-6-methylcyclohexa-1,3-dien-1-yl)piperazine?
The InChIKey is LATHHGYEVWRFAP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17FN2/c1-9-10(12)3-2-4-11(9)14-7-5-13-6-8-14/h2-4,9-10,13H,5-8H2,1H3.
What are the key properties of 1-(5-fluoro-6-methylcyclohexa-1,3-dien-1-yl)piperazine?
1-(5-fluoro-6-methylcyclohexa-1,3-dien-1-yl)piperazine has a molecular weight of 196.27 g/mol, XLogP of 1.32, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(5-fluoro-6-methylcyclohexa-1,3-dien-1-yl)piperazine is sourced from PubChem (CID 146265962), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).