C31H53FN4O8 — CID 146266242
[(2R)-2-[[5-methoxy-4-[(2S,3R)-2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]octan-6-yl]oxycarbonylamino]-3-methylbutyl] N-[6-[[2-(fluoroamino)acetyl]amino]hexyl]carbamate (PubChem CID 146266242) has the molecular formula C31H53FN4O8 and a molecular weight of 628.78 g/mol. Its IUPAC name is [(2R)-2-[[5-methoxy-4-[(2S,3R)-2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]octan-6-yl]oxycarbonylamino]-3-methylbutyl] N-[6-[[2-(fluoroamino)acetyl]amino]hexyl]carbamate.
| Compound Name | [(2R)-2-[[5-methoxy-4-[(2S,3R)-2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]octan-6-yl]oxycarbonylamino]-3-methylbutyl] N-[6-[[2-(fluoroamino)acetyl]amino]hexyl]carbamate |
|---|---|
| PubChem CID | 146266242 |
| Molecular Formula | C31H53FN4O8 |
| Molecular Weight | 628.78 g/mol |
| Exact Mass | 628.38 |
| IUPAC Name | [(2R)-2-[[5-methoxy-4-[(2S,3R)-2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]octan-6-yl]oxycarbonylamino]-3-methylbutyl] N-[6-[[2-(fluoroamino)acetyl]amino]hexyl]carbamate |
| SMILES | COC1C(OC(=O)N[C@@H](COC(=O)NCCCCCCNC(=O)CNF)C(C)C)CCC2(CO2)C1C1(C)O[C@@H]1CC=C(C)C |
| InChI | InChI=1S/C31H53FN4O8/c1-20(2)11-12-24-30(5,44-24)27-26(40-6)23(13-14-31(27)19-42-31)43-29(39)36-22(21(3)4)18-41-28(38)34-16-10-8-7-9-15-33-25(37)17-35-32/h11,21-24,26-27,35H,7-10,12-19H2,1-6H3,(H,33,37)(H,34,38)(H,36,39)/t22-,23?,24+,26?,27?,30?,31?/m0/s1 |
| InChIKey | KOEKMCAPVDSKLY-CXFXRYJJSA-N |
| XLogP | 3.69 |
| TPSA | 152.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.78 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|