C45H28N4O — CID 146266717
9-[3-[4-phenyl-6-(9-phenyldibenzofuran-3-yl)-1,3,5-triazin-2-yl]phenyl]carbazole (PubChem CID 146266717) has the molecular formula C45H28N4O and a molecular weight of 640.75 g/mol. Its IUPAC name is 9-[3-[4-phenyl-6-(9-phenyldibenzofuran-3-yl)-1,3,5-triazin-2-yl]phenyl]carbazole.
| Compound Name | 9-[3-[4-phenyl-6-(9-phenyldibenzofuran-3-yl)-1,3,5-triazin-2-yl]phenyl]carbazole |
|---|---|
| PubChem CID | 146266717 |
| Molecular Formula | C45H28N4O |
| Molecular Weight | 640.75 g/mol |
| Exact Mass | 640.23 |
| IUPAC Name | 9-[3-[4-phenyl-6-(9-phenyldibenzofuran-3-yl)-1,3,5-triazin-2-yl]phenyl]carbazole |
| SMILES | c1ccc(-c2nc(-c3cccc(-n4c5ccccc5c5ccccc54)c3)nc(-c3ccc4c(c3)oc3cccc(-c5ccccc5)c34)n2)cc1 |
| InChI | InChI=1S/C45H28N4O/c1-3-13-29(14-4-1)34-21-12-24-40-42(34)37-26-25-32(28-41(37)50-40)45-47-43(30-15-5-2-6-16-30)46-44(48-45)31-17-11-18-33(27-31)49-38-22-9-7-19-35(38)36-20-8-10-23-39(36)49/h1-28H |
| InChIKey | KKXANFQDCUQIMI-UHFFFAOYSA-N |
| XLogP | 11.54 |
| TPSA | 56.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.75 |
| LogP ≤ 5 | 11.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |