C16H11BrF2N6O3 — CID 146266810
1-[4-[N'-(3-bromo-4-fluorophenyl)-N-hydroxycarbamimidoyl]-1,2,5-oxadiazol-3-yl]-3-(4-fluorophenyl)urea (PubChem CID 146266810) has the molecular formula C16H11BrF2N6O3 and a molecular weight of 453.20 g/mol. Its IUPAC name is 1-[4-[N'-(3-bromo-4-fluorophenyl)-N-hydroxycarbamimidoyl]-1,2,5-oxadiazol-3-yl]-3-(4-fluorophenyl)urea.
| Compound Name | 1-[4-[N'-(3-bromo-4-fluorophenyl)-N-hydroxycarbamimidoyl]-1,2,5-oxadiazol-3-yl]-3-(4-fluorophenyl)urea |
|---|---|
| PubChem CID | 146266810 |
| Molecular Formula | C16H11BrF2N6O3 |
| Molecular Weight | 453.20 g/mol |
| Exact Mass | 452.00 |
| IUPAC Name | 1-[4-[N'-(3-bromo-4-fluorophenyl)-N-hydroxycarbamimidoyl]-1,2,5-oxadiazol-3-yl]-3-(4-fluorophenyl)urea |
| SMILES | O=C(Nc1ccc(F)cc1)Nc1nonc1/C(=N/c1ccc(F)c(Br)c1)NO |
| InChI | InChI=1S/C16H11BrF2N6O3/c17-11-7-10(5-6-12(11)19)20-14(23-27)13-15(25-28-24-13)22-16(26)21-9-3-1-8(18)2-4-9/h1-7,27H,(H,20,23)(H2,21,22,25,26) |
| InChIKey | LZJCFZVMUJFGJV-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 124.67 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.20 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|