C16H14F3N3O3 — CID 146266907
methyl (2S)-2-(pyrazine-2-carbonylamino)-3-[4-(trifluoromethyl)phenyl]propanoate (PubChem CID 146266907) has the molecular formula C16H14F3N3O3 and a molecular weight of 353.30 g/mol. Its IUPAC name is methyl (2S)-2-(pyrazine-2-carbonylamino)-3-[4-(trifluoromethyl)phenyl]propanoate.
| Compound Name | methyl (2S)-2-(pyrazine-2-carbonylamino)-3-[4-(trifluoromethyl)phenyl]propanoate |
|---|---|
| PubChem CID | 146266907 |
| Molecular Formula | C16H14F3N3O3 |
| Molecular Weight | 353.30 g/mol |
| Exact Mass | 353.10 |
| IUPAC Name | methyl (2S)-2-(pyrazine-2-carbonylamino)-3-[4-(trifluoromethyl)phenyl]propanoate |
| SMILES | COC(=O)[C@H](Cc1ccc(C(F)(F)F)cc1)NC(=O)c1cnccn1 |
| InChI | InChI=1S/C16H14F3N3O3/c1-25-15(24)12(22-14(23)13-9-20-6-7-21-13)8-10-2-4-11(5-3-10)16(17,18)19/h2-7,9,12H,8H2,1H3,(H,22,23)/t12-/m0/s1 |
| InChIKey | HWRHMALYZCGDAO-LBPRGKRZSA-N |
| XLogP | 2.01 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.30 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |