C17H17BrF3N3 — CID 146266963
(1S,3R)-1-(5-bromo-2-pyridinyl)-3-methyl-2-(2,2,2-trifluoroethyl)-3,4-dihydro-1H-isoquinolin-6-amine (PubChem CID 146266963) has the molecular formula C17H17BrF3N3 and a molecular weight of 400.24 g/mol. Its IUPAC name is (1S,3R)-1-(5-bromo-2-pyridinyl)-3-methyl-2-(2,2,2-trifluoroethyl)-3,4-dihydro-1H-isoquinolin-6-amine.
| Compound Name | (1S,3R)-1-(5-bromo-2-pyridinyl)-3-methyl-2-(2,2,2-trifluoroethyl)-3,4-dihydro-1H-isoquinolin-6-amine |
|---|---|
| PubChem CID | 146266963 |
| Molecular Formula | C17H17BrF3N3 |
| Molecular Weight | 400.24 g/mol |
| Exact Mass | 399.06 |
| IUPAC Name | (1S,3R)-1-(5-bromo-2-pyridinyl)-3-methyl-2-(2,2,2-trifluoroethyl)-3,4-dihydro-1H-isoquinolin-6-amine |
| SMILES | C[C@@H]1Cc2cc(N)ccc2[C@@H](c2ccc(Br)cn2)N1CC(F)(F)F |
| InChI | InChI=1S/C17H17BrF3N3/c1-10-6-11-7-13(22)3-4-14(11)16(24(10)9-17(19,20)21)15-5-2-12(18)8-23-15/h2-5,7-8,10,16H,6,9,22H2,1H3/t10-,16+/m1/s1 |
| InChIKey | BARCNMICZFYSON-HWPZZCPQSA-N |
| XLogP | 4.32 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.24 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|