C19H17BrF3N5 — CID 146267014
(1S,3R)-1-(5-bromo-2-pyridinyl)-3-methyl-6-(1H-1,2,4-triazol-5-yl)-2-(2,2,2-trifluoroethyl)-3,4-dihydro-1H-isoquinoline (PubChem CID 146267014) has the molecular formula C19H17BrF3N5 and a molecular weight of 452.28 g/mol. Its IUPAC name is (1S,3R)-1-(5-bromo-2-pyridinyl)-3-methyl-6-(1H-1,2,4-triazol-5-yl)-2-(2,2,2-trifluoroethyl)-3,4-dihydro-1H-isoquinoline.
| Compound Name | (1S,3R)-1-(5-bromo-2-pyridinyl)-3-methyl-6-(1H-1,2,4-triazol-5-yl)-2-(2,2,2-trifluoroethyl)-3,4-dihydro-1H-isoquinoline |
|---|---|
| PubChem CID | 146267014 |
| Molecular Formula | C19H17BrF3N5 |
| Molecular Weight | 452.28 g/mol |
| Exact Mass | 451.06 |
| IUPAC Name | (1S,3R)-1-(5-bromo-2-pyridinyl)-3-methyl-6-(1H-1,2,4-triazol-5-yl)-2-(2,2,2-trifluoroethyl)-3,4-dihydro-1H-isoquinoline |
| SMILES | C[C@@H]1Cc2cc(-c3ncn[nH]3)ccc2[C@@H](c2ccc(Br)cn2)N1CC(F)(F)F |
| InChI | InChI=1S/C19H17BrF3N5/c1-11-6-13-7-12(18-25-10-26-27-18)2-4-15(13)17(28(11)9-19(21,22)23)16-5-3-14(20)8-24-16/h2-5,7-8,10-11,17H,6,9H2,1H3,(H,25,26,27)/t11-,17+/m1/s1 |
| InChIKey | DEQPTGHHZLHSSL-DIFFPNOSSA-N |
| XLogP | 4.53 |
| TPSA | 57.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.28 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |