C13H22F3N — CID 146267030
(3S,5E)-5-ethyl-N-methyl-N-(2,2,2-trifluoroethyl)octa-1,5-dien-3-amine (PubChem CID 146267030) has the molecular formula C13H22F3N and a molecular weight of 249.32 g/mol. Its IUPAC name is (3S,5E)-5-ethyl-N-methyl-N-(2,2,2-trifluoroethyl)octa-1,5-dien-3-amine.
| Compound Name | (3S,5E)-5-ethyl-N-methyl-N-(2,2,2-trifluoroethyl)octa-1,5-dien-3-amine |
|---|---|
| PubChem CID | 146267030 |
| Molecular Formula | C13H22F3N |
| Molecular Weight | 249.32 g/mol |
| Exact Mass | 249.17 |
| IUPAC Name | (3S,5E)-5-ethyl-N-methyl-N-(2,2,2-trifluoroethyl)octa-1,5-dien-3-amine |
| SMILES | C=C[C@H](C/C(=C/CC)CC)N(C)CC(F)(F)F |
| InChI | InChI=1S/C13H22F3N/c1-5-8-11(6-2)9-12(7-3)17(4)10-13(14,15)16/h7-8,12H,3,5-6,9-10H2,1-2,4H3/b11-8+/t12-/m1/s1 |
| InChIKey | CVYFCEJXCYPUHT-JATZPVMKSA-N |
| XLogP | 4.17 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.32 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|