About (Z,2E)-5-[chloro(tetrafluoro)-λ6-sulfanyl]-1-phenyl-2-propylidenehex-3-en-1-one
(Z,2E)-5-[chloro(tetrafluoro)-λ6-sulfanyl]-1-phenyl-2-propylidenehex-3-en-1-one (PubChem CID 146268234) has the molecular formula C15H17ClF4OS
and a molecular weight of 356.81 g/mol. Its IUPAC name is (Z,2E)-5-[chloro(tetrafluoro)-λ6-sulfanyl]-1-phenyl-2-propylidenehex-3-en-1-one.
Molecular Properties
| Compound Name | (Z,2E)-5-[chloro(tetrafluoro)-λ6-sulfanyl]-1-phenyl-2-propylidenehex-3-en-1-one |
| PubChem CID | 146268234 |
| Molecular Formula | C15H17ClF4OS |
| Molecular Weight | 356.81 g/mol |
| Exact Mass | 356.06 |
| IUPAC Name | (Z,2E)-5-[chloro(tetrafluoro)-λ6-sulfanyl]-1-phenyl-2-propylidenehex-3-en-1-one |
| SMILES | CC/C=C(\C=C/C(C)S(F)(F)(F)(F)Cl)C(=O)c1ccccc1 |
| InChI | InChI=1S/C15H17ClF4OS/c1-3-7-13(15(21)14-8-5-4-6-9-14)11-10-12(2)22(16,17,18,19)20/h4-12H,3H2,1-2H3/b11-10-,13-7+ |
| InChIKey | SJNKXMALGGHEKV-PCGFSOLGSA-N |
| XLogP | 6.72 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 356.81 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (Z,2E)-5-[chloro(tetrafluoro)-λ6-sulfanyl]-1-phenyl-2-propylidenehex-3-en-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z,2E)-5-[chloro(tetrafluoro)-λ6-sulfanyl]-1-phenyl-2-propylidenehex-3-en-1-one?
The IUPAC name of (Z,2E)-5-[chloro(tetrafluoro)-λ6-sulfanyl]-1-phenyl-2-propylidenehex-3-en-1-one (CID 146268234) is (Z,2E)-5-[chloro(tetrafluoro)-λ6-sulfanyl]-1-phenyl-2-propylidenehex-3-en-1-one.
What is the SMILES notation for (Z,2E)-5-[chloro(tetrafluoro)-λ6-sulfanyl]-1-phenyl-2-propylidenehex-3-en-1-one?
The canonical SMILES for (Z,2E)-5-[chloro(tetrafluoro)-λ6-sulfanyl]-1-phenyl-2-propylidenehex-3-en-1-one is CC/C=C(\C=C/C(C)S(F)(F)(F)(F)Cl)C(=O)c1ccccc1.
What is the InChIKey of (Z,2E)-5-[chloro(tetrafluoro)-λ6-sulfanyl]-1-phenyl-2-propylidenehex-3-en-1-one?
The InChIKey is SJNKXMALGGHEKV-PCGFSOLGSA-N. The full InChI is InChI=1S/C15H17ClF4OS/c1-3-7-13(15(21)14-8-5-4-6-9-14)11-10-12(2)22(16,17,18,19)20/h4-12H,3H2,1-2H3/b11-10-,13-7+.
What are the key properties of (Z,2E)-5-[chloro(tetrafluoro)-λ6-sulfanyl]-1-phenyl-2-propylidenehex-3-en-1-one?
(Z,2E)-5-[chloro(tetrafluoro)-λ6-sulfanyl]-1-phenyl-2-propylidenehex-3-en-1-one has a molecular weight of 356.81 g/mol, XLogP of 6.72, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (Z,2E)-5-[chloro(tetrafluoro)-λ6-sulfanyl]-1-phenyl-2-propylidenehex-3-en-1-one is sourced from PubChem (CID 146268234), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).