C32H45FN2O7S2 — CID 146268759
3-[[3,3-dibutyl-1,1-dihydroxy-5-[4-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]-7-methylsulfanyl-2,4-dihydro-1λ4,5-benzothiazepin-8-yl]oxy]-2-fluoroprop-2-enoic acid (PubChem CID 146268759) has the molecular formula C32H45FN2O7S2 and a molecular weight of 652.85 g/mol. Its IUPAC name is 3-[[3,3-dibutyl-1,1-dihydroxy-5-[4-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]-7-methylsulfanyl-2,4-dihydro-1λ4,5-benzothiazepin-8-yl]oxy]-2-fluoroprop-2-enoic acid.
| Compound Name | 3-[[3,3-dibutyl-1,1-dihydroxy-5-[4-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]-7-methylsulfanyl-2,4-dihydro-1λ4,5-benzothiazepin-8-yl]oxy]-2-fluoroprop-2-enoic acid |
|---|---|
| PubChem CID | 146268759 |
| Molecular Formula | C32H45FN2O7S2 |
| Molecular Weight | 652.85 g/mol |
| Exact Mass | 652.27 |
| IUPAC Name | 3-[[3,3-dibutyl-1,1-dihydroxy-5-[4-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]-7-methylsulfanyl-2,4-dihydro-1λ4,5-benzothiazepin-8-yl]oxy]-2-fluoroprop-2-enoic acid |
| SMILES | CCCCC1(CCCC)CN(c2ccc(NC(=O)OC(C)(C)C)cc2)c2cc(SC)c(OC=C(F)C(=O)O)cc2S(O)(O)C1 |
| InChI | InChI=1S/C32H45FN2O7S2/c1-7-9-15-32(16-10-8-2)20-35(23-13-11-22(12-14-23)34-30(38)42-31(3,4)5)25-17-27(43-6)26(41-19-24(33)29(36)37)18-28(25)44(39,40)21-32/h11-14,17-19,39-40H,7-10,15-16,20-21H2,1-6H3,(H,34,38)(H,36,37) |
| InChIKey | ZXEAOLYDUVEXEN-UHFFFAOYSA-N |
| XLogP | 9.66 |
| TPSA | 128.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.85 |
| LogP ≤ 5 | 9.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|