C25H32FNO5S2 — CID 146268777
3-[(3-butyl-3-ethyl-1,1-dihydroxy-7-methylsulfanyl-5-phenyl-2,4-dihydro-1λ4,5-benzothiazepin-8-yl)oxy]-2-fluoroprop-2-enoic acid (PubChem CID 146268777) has the molecular formula C25H32FNO5S2 and a molecular weight of 509.67 g/mol. Its IUPAC name is 3-[(3-butyl-3-ethyl-1,1-dihydroxy-7-methylsulfanyl-5-phenyl-2,4-dihydro-1λ4,5-benzothiazepin-8-yl)oxy]-2-fluoroprop-2-enoic acid.
| Compound Name | 3-[(3-butyl-3-ethyl-1,1-dihydroxy-7-methylsulfanyl-5-phenyl-2,4-dihydro-1λ4,5-benzothiazepin-8-yl)oxy]-2-fluoroprop-2-enoic acid |
|---|---|
| PubChem CID | 146268777 |
| Molecular Formula | C25H32FNO5S2 |
| Molecular Weight | 509.67 g/mol |
| Exact Mass | 509.17 |
| IUPAC Name | 3-[(3-butyl-3-ethyl-1,1-dihydroxy-7-methylsulfanyl-5-phenyl-2,4-dihydro-1λ4,5-benzothiazepin-8-yl)oxy]-2-fluoroprop-2-enoic acid |
| SMILES | CCCCC1(CC)CN(c2ccccc2)c2cc(SC)c(OC=C(F)C(=O)O)cc2S(O)(O)C1 |
| InChI | InChI=1S/C25H32FNO5S2/c1-4-6-12-25(5-2)16-27(18-10-8-7-9-11-18)20-13-22(33-3)21(32-15-19(26)24(28)29)14-23(20)34(30,31)17-25/h7-11,13-15,30-31H,4-6,12,16-17H2,1-3H3,(H,28,29) |
| InChIKey | NTSXFHMQVJRVOS-UHFFFAOYSA-N |
| XLogP | 7.53 |
| TPSA | 90.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.67 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|