C30H41FN2O5S2 — CID 146268778
(Z)-3-[[3,3-dibutyl-7-methylsulfanyl-1,1-dioxo-5-[4-(propylamino)phenyl]-2,4-dihydro-1λ6,5-benzothiazepin-8-yl]oxy]-2-fluoroprop-2-enoic acid (PubChem CID 146268778) has the molecular formula C30H41FN2O5S2 and a molecular weight of 592.80 g/mol. Its IUPAC name is (Z)-3-[[3,3-dibutyl-7-methylsulfanyl-1,1-dioxo-5-[4-(propylamino)phenyl]-2,4-dihydro-1λ6,5-benzothiazepin-8-yl]oxy]-2-fluoroprop-2-enoic acid.
| Compound Name | (Z)-3-[[3,3-dibutyl-7-methylsulfanyl-1,1-dioxo-5-[4-(propylamino)phenyl]-2,4-dihydro-1λ6,5-benzothiazepin-8-yl]oxy]-2-fluoroprop-2-enoic acid |
|---|---|
| PubChem CID | 146268778 |
| Molecular Formula | C30H41FN2O5S2 |
| Molecular Weight | 592.80 g/mol |
| Exact Mass | 592.24 |
| IUPAC Name | (Z)-3-[[3,3-dibutyl-7-methylsulfanyl-1,1-dioxo-5-[4-(propylamino)phenyl]-2,4-dihydro-1λ6,5-benzothiazepin-8-yl]oxy]-2-fluoroprop-2-enoic acid |
| SMILES | CCCCC1(CCCC)CN(c2ccc(NCCC)cc2)c2cc(SC)c(O/C=C(\F)C(=O)O)cc2S(=O)(=O)C1 |
| InChI | InChI=1S/C30H41FN2O5S2/c1-5-8-14-30(15-9-6-2)20-33(23-12-10-22(11-13-23)32-16-7-3)25-17-27(39-4)26(38-19-24(31)29(34)35)18-28(25)40(36,37)21-30/h10-13,17-19,32H,5-9,14-16,20-21H2,1-4H3,(H,34,35)/b24-19- |
| InChIKey | TXCBGUQYMSIMCR-CLCOLTQESA-N |
| XLogP | 7.80 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.80 |
| LogP ≤ 5 | 7.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|