C30H41FN2O6S2 — CID 146268781
3-[[3,3-dibutyl-1,1-dihydroxy-7-methylsulfanyl-5-[4-(propanoylamino)phenyl]-2,4-dihydro-1λ4,5-benzothiazepin-8-yl]oxy]-2-fluoroprop-2-enoic acid (PubChem CID 146268781) has the molecular formula C30H41FN2O6S2 and a molecular weight of 608.80 g/mol. Its IUPAC name is 3-[[3,3-dibutyl-1,1-dihydroxy-7-methylsulfanyl-5-[4-(propanoylamino)phenyl]-2,4-dihydro-1λ4,5-benzothiazepin-8-yl]oxy]-2-fluoroprop-2-enoic acid.
| Compound Name | 3-[[3,3-dibutyl-1,1-dihydroxy-7-methylsulfanyl-5-[4-(propanoylamino)phenyl]-2,4-dihydro-1λ4,5-benzothiazepin-8-yl]oxy]-2-fluoroprop-2-enoic acid |
|---|---|
| PubChem CID | 146268781 |
| Molecular Formula | C30H41FN2O6S2 |
| Molecular Weight | 608.80 g/mol |
| Exact Mass | 608.24 |
| IUPAC Name | 3-[[3,3-dibutyl-1,1-dihydroxy-7-methylsulfanyl-5-[4-(propanoylamino)phenyl]-2,4-dihydro-1λ4,5-benzothiazepin-8-yl]oxy]-2-fluoroprop-2-enoic acid |
| SMILES | CCCCC1(CCCC)CN(c2ccc(NC(=O)CC)cc2)c2cc(SC)c(OC=C(F)C(=O)O)cc2S(O)(O)C1 |
| InChI | InChI=1S/C30H41FN2O6S2/c1-5-8-14-30(15-9-6-2)19-33(22-12-10-21(11-13-22)32-28(34)7-3)24-16-26(40-4)25(39-18-23(31)29(35)36)17-27(24)41(37,38)20-30/h10-13,16-18,37-38H,5-9,14-15,19-20H2,1-4H3,(H,32,34)(H,35,36) |
| InChIKey | BGTZRQIOGAXEJD-UHFFFAOYSA-N |
| XLogP | 8.66 |
| TPSA | 119.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.80 |
| LogP ≤ 5 | 8.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|