C28H36FNO5S2 — CID 146268791
(Z)-3-[(3,3-dibutyl-7-ethylsulfanyl-1,1-dioxo-5-phenyl-2,4-dihydro-1λ6,5-benzothiazepin-8-yl)oxy]-2-fluoroprop-2-enoic acid (PubChem CID 146268791) has the molecular formula C28H36FNO5S2 and a molecular weight of 549.73 g/mol. Its IUPAC name is (Z)-3-[(3,3-dibutyl-7-ethylsulfanyl-1,1-dioxo-5-phenyl-2,4-dihydro-1λ6,5-benzothiazepin-8-yl)oxy]-2-fluoroprop-2-enoic acid.
| Compound Name | (Z)-3-[(3,3-dibutyl-7-ethylsulfanyl-1,1-dioxo-5-phenyl-2,4-dihydro-1λ6,5-benzothiazepin-8-yl)oxy]-2-fluoroprop-2-enoic acid |
|---|---|
| PubChem CID | 146268791 |
| Molecular Formula | C28H36FNO5S2 |
| Molecular Weight | 549.73 g/mol |
| Exact Mass | 549.20 |
| IUPAC Name | (Z)-3-[(3,3-dibutyl-7-ethylsulfanyl-1,1-dioxo-5-phenyl-2,4-dihydro-1λ6,5-benzothiazepin-8-yl)oxy]-2-fluoroprop-2-enoic acid |
| SMILES | CCCCC1(CCCC)CN(c2ccccc2)c2cc(SCC)c(O/C=C(\F)C(=O)O)cc2S(=O)(=O)C1 |
| InChI | InChI=1S/C28H36FNO5S2/c1-4-7-14-28(15-8-5-2)19-30(21-12-10-9-11-13-21)23-16-25(36-6-3)24(35-18-22(29)27(31)32)17-26(23)37(33,34)20-28/h9-13,16-18H,4-8,14-15,19-20H2,1-3H3,(H,31,32)/b22-18- |
| InChIKey | QUABRCDBRFSDIA-PYCFMQQDSA-N |
| XLogP | 7.37 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.73 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|