C27H36FNO5S2 — CID 146268796
3-[(3,3-dibutyl-1,1-dihydroxy-7-methylsulfanyl-5-phenyl-2,4-dihydro-1λ4,5-benzothiazepin-8-yl)oxy]-2-fluoroprop-2-enoic acid (PubChem CID 146268796) has the molecular formula C27H36FNO5S2 and a molecular weight of 537.72 g/mol. Its IUPAC name is 3-[(3,3-dibutyl-1,1-dihydroxy-7-methylsulfanyl-5-phenyl-2,4-dihydro-1λ4,5-benzothiazepin-8-yl)oxy]-2-fluoroprop-2-enoic acid.
| Compound Name | 3-[(3,3-dibutyl-1,1-dihydroxy-7-methylsulfanyl-5-phenyl-2,4-dihydro-1λ4,5-benzothiazepin-8-yl)oxy]-2-fluoroprop-2-enoic acid |
|---|---|
| PubChem CID | 146268796 |
| Molecular Formula | C27H36FNO5S2 |
| Molecular Weight | 537.72 g/mol |
| Exact Mass | 537.20 |
| IUPAC Name | 3-[(3,3-dibutyl-1,1-dihydroxy-7-methylsulfanyl-5-phenyl-2,4-dihydro-1λ4,5-benzothiazepin-8-yl)oxy]-2-fluoroprop-2-enoic acid |
| SMILES | CCCCC1(CCCC)CN(c2ccccc2)c2cc(SC)c(OC=C(F)C(=O)O)cc2S(O)(O)C1 |
| InChI | InChI=1S/C27H36FNO5S2/c1-4-6-13-27(14-7-5-2)18-29(20-11-9-8-10-12-20)22-15-24(35-3)23(34-17-21(28)26(30)31)16-25(22)36(32,33)19-27/h8-12,15-17,32-33H,4-7,13-14,18-19H2,1-3H3,(H,30,31) |
| InChIKey | SPIQQIIAQWIBLK-UHFFFAOYSA-N |
| XLogP | 8.31 |
| TPSA | 90.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.72 |
| LogP ≤ 5 | 8.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|