C28H36FNO6S2 — CID 146268800
(Z)-3-[[3,3-dibutyl-5-(4-methoxyphenyl)-7-methylsulfanyl-1,1-dioxo-2,4-dihydro-1λ6,5-benzothiazepin-8-yl]oxy]-2-fluoroprop-2-enoic acid (PubChem CID 146268800) has the molecular formula C28H36FNO6S2 and a molecular weight of 565.73 g/mol. Its IUPAC name is (Z)-3-[[3,3-dibutyl-5-(4-methoxyphenyl)-7-methylsulfanyl-1,1-dioxo-2,4-dihydro-1λ6,5-benzothiazepin-8-yl]oxy]-2-fluoroprop-2-enoic acid.
| Compound Name | (Z)-3-[[3,3-dibutyl-5-(4-methoxyphenyl)-7-methylsulfanyl-1,1-dioxo-2,4-dihydro-1λ6,5-benzothiazepin-8-yl]oxy]-2-fluoroprop-2-enoic acid |
|---|---|
| PubChem CID | 146268800 |
| Molecular Formula | C28H36FNO6S2 |
| Molecular Weight | 565.73 g/mol |
| Exact Mass | 565.20 |
| IUPAC Name | (Z)-3-[[3,3-dibutyl-5-(4-methoxyphenyl)-7-methylsulfanyl-1,1-dioxo-2,4-dihydro-1λ6,5-benzothiazepin-8-yl]oxy]-2-fluoroprop-2-enoic acid |
| SMILES | CCCCC1(CCCC)CN(c2ccc(OC)cc2)c2cc(SC)c(O/C=C(\F)C(=O)O)cc2S(=O)(=O)C1 |
| InChI | InChI=1S/C28H36FNO6S2/c1-5-7-13-28(14-8-6-2)18-30(20-9-11-21(35-3)12-10-20)23-15-25(37-4)24(36-17-22(29)27(31)32)16-26(23)38(33,34)19-28/h9-12,15-17H,5-8,13-14,18-19H2,1-4H3,(H,31,32)/b22-17- |
| InChIKey | PVGBCCRREIJJSI-XLNRJJMWSA-N |
| XLogP | 6.98 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.73 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|